
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 151157-48-1 |
| Catalog No. | 2A-9071864 |
| Chinese Name | 1-(2-氟苯基)环丁烷-1-羧酸 |
| Synonyms | 1-(2-FLUOROPHENYL)CYCLOBUTANECARBOXYLIC ACID; 1-Carboxy-1-(2-fluorophenyl)cyclobutane |
| Molecular Formula | C11H11FO2 |
| Molecular Weight | 194.20200 |
| Density | 1.294 g/cm3 |
| Boiling Point | 325.936ºC at 760 mmHg |
| Appearance | white solid |
| Storage Condition | 2-8℃ |
| HTC | 2916399090 |
| PubChem ID | 39958077 |
| SMILES | O=C(O)C1(c2ccccc2F)CCC1 |
| InChI | InChI=1S/C11H11FO2/c12-9-5-2-1-4-8(9)11(10(13)14)6-3-7-11/h1-2,4-5H,3,6-7H2,(H,13,14) |
| InChI Key | SUVDKDZUAMNVGY-UHFFFAOYSA-N |
| MSDS | msds/71864_1_151157_48_1.pdf |
| Use of | Properties Chemical & Physical Properties |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(2-aminoethyl)-2-(methylamino)benzamide | 174878-15-0 | 2A-9071859 |
| 1-(2-Fluorophenyl)cyclobutanaminehydrochloride | 1228879-28-4 | 2A-9071860 |
| 4'-[{1,4'-Dimethyl-2'-propyl[2,6'-Bi-1H-benzimiaszol]-1'yl}-methyl}-1,1'-biphenyl-2-caroxylicaciddimethylethylester | 144702-26-1 | 2A-9071861 |
| benzyl4-(aminomethyl)phenylcarbamate | 443331-14-4 | 2A-9071862 |
| (1-(2-Fluorophenyl)cyclobutyl)methanaminehydrochloride | 1228879-43-3 | 2A-9071863 |
| tert-butyl4-aminobenzylcarbamate | 94835-55-8 | 2A-9071865 |
| Methyl-3-oxo-2-oximinobutyrate | 73708-93-9 | 2A-9071867 |
| 1,3,4-oxadiazol-2-amine | 3775-60-8 | 2A-9071868 |
| "1-Ethyl-3-methylimidazoliumtetrafluoroborate | 143314-16-3 | 2A-9071869 |
| 1,3,4,6-Tetra-O-acetyl-beta-D-mannopyranose | 18968-05-3 | 2A-9071871 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA