
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 263917-74-4 |
| Catalog No. | 2A-9071770 |
| Chinese Name | 2-Methoxy-N-methyl-N-phenylaniline |
| Molecular Formula | C14H15NO |
| Molecular Weight | 197.16 |
| Appearance | solid |
| HTC | 2922299090 |
| PubChem ID | 329826183 |
| MDL Number | MFCD22123286 |
| SMILES | CON(C)C(=O)[C@H]1C[C@@H]1C(F)(F)F |
| InChI | 1S/C7H10F3NO2/c1-11(13-2)6(12)4-3-5(4)7(8,9)10/h4-5H,3H2,1-2H3/t4-,5-/m0/s1 |
| InChI Key | ULYLGHYOCDXXMC-WHFBIAKZSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/71770_1_263917_74_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Bromo-4-Chloro-2-fluoro-benzoicacidmethylester | 951884-02-9 | 2A-9071764 |
| N-(2-methoxyphenyl)-2,5-dimethylaniline | 211292-60-3 | 2A-9071765 |
| Terephthalylidenedicamphorsulfonieacid | 90457-82-2 | 2A-9071766 |
| 4-Chloro-2-fluoro-benzoicacidmethylester | 148893-72-5 | 2A-9071767 |
| 5-Bromo-4-chloro-2-fluoro-benzoicacid | 289038-22-8 | 2A-9071769 |
| 2-Amino-5,6-dihydro-4H-benzothiazol-7-onehydrobromide | 805250-54-8 | 2A-9071771 |
| 2,3,3,3-Tetrafluoropropanoicacid | 359-49-9 | 2A-9071772 |
| N-cyclohexyl-2-methoxyaniline | 850570-34-2 | 2A-9071774 |
| N,N-Diethyl-2,3,3,3-tetrafluoropropionamide | 392-63-2 | 2A-9071776 |
| 2,2-Dibromo-1-thiophen-2-ylethanone | 68672-88-8 | 2A-9071778 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA