
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13472-84-9 |
| Catalog No. | 2A-9071629 |
| Chinese Name | 3-氯-2-甲氧基吡啶 |
| Synonyms | 3-Chloro-2-methoxypyridine; MFCD03095227 |
| Molecular Formula | C6H6ClNO |
| Molecular Weight | 143.57 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 171.1±20.0 °C at 760 mmHg |
| Melting Point | 204-205°C |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | Sealed at room temperature, cool, ventilated and d |
| Packaging | III |
| HTC | 2933399090 |
| PubChem ID | 32810350 |
| SMILES | COc1ncccc1Cl |
| InChI | InChI=1S/C6H6ClNO/c1-9-6-5(7)3-2-4-8-6/h2-4H,1H3 |
| InChI Key | MSICGKUDCSUMJZ-UHFFFAOYSA-N |
| Hazard Symbols | Category 3 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1993 Proper shipping name: Flammable Liquid, not otherwise specified Packing grade: III |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-bromoisothiazole | 55512-82-8 | 2A-9071621 |
| 2-chloro-3-methoxy-6-nitropyridine | 886371-75-1 | 2A-9071624 |
| 5-bromo-2-butoxypyridine | 158615-97-5 | 2A-9071626 |
| 5-bromo-2-(2,2,2-trifluoroethoxy)pyridine | 126728-58-3 | 2A-9071627 |
| 5-bromo-2-phenoxypyridine | 59717-96-3 | 2A-9071628 |
| 4-bromo-2-ethylpyridine | 156761-88-5 | 2A-9071633 |
| 3-bromo-5-nitro-1H-indole | 67400-25-3 | 2A-9071634 |
| 2-Chloromethyl-4-nitro-pyridine | 312321-71-4 | 2A-9071635 |
| 3-Amino-6-chloro-5-methoxypyridine | 75711-01-2 | 2A-9071641 |
| 6-Chloro-2-hydroxypyrazine | 4925-61-5 | 2A-9071643 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA