
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 864773-64-8 |
| Catalog No. | 2A-9071618 |
| Chinese Name | 1-(5-溴-2,4-二氟苯基)乙酮 |
| Synonyms | FR CF DE FV1; 1-(5-Bromo-2,4-difluorophenyl)ethanone |
| Molecular Formula | C8H5BrF2O |
| Molecular Weight | 235.03 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 254.0±40.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2914700090 |
| PubChem ID | 34092804 |
| SMILES | CC(=O)c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C8H5BrF2O/c1-4(12)5-2-6(9)8(11)3-7(5)10/h2-3H,1H3 |
| InChI Key | KXZHDRBQPYKHKS-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 5-Dimethylamino-2-(2,2,2-trifluoro-acetyl)-penta-2,4-dienoicacidethylester | 1146961-22-9 | 2A-9071209 |
| 3-(4-Methoxy-benzyl)-2,4-dioxo-1,3,4,5,7,8-hexahydro-2H-pyrido[4,3-d]pyrimidine- | 947404-33-3 | 2A-9071283 |
| 3-(4-Methoxy-benzyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione | 1223888-84-3 | 2A-9071485 |
| 5-Pyridin-3-yl-2,4-dihydro-[1,2,4]triazol-3-one | 59282-83-6 | 2A-9071523 |
| 1,5-dibromo-2,4-difluorobenzene | 28342-75-8 | 2A-9071590 |
| Methyl2,4-dinitrophenylacetate | 58605-12-2 | 2A-9071657 |
| 2-(2,4-Dinitro-phenoxy)-isoindole-1,3-dione | 60506-35-6 | 2A-9071743 |
| 1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazole-1-yl)-1-ethanone | 863867-75-6 | 2A-9071786 |
| 1-tert-Butyl-2,4-dinitrobenzene | 4160-54-7 | 2A-9071798 |
| 2,4-difluoro-N-(2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)benzenesulfonamide | 1083326-73-1 | 2A-9071888 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA