
CAS Number55251-46-2
Synonyms4-methoxy-n-methyl diphenylamine; N-methyl-(p-methoxyphenyl)phenylamine; N-(4-methoxyphenyl)-N-methylphenylamine; 4-methoxy-N-methyl-N-phenyl-aniline; N-methyl-N-(4-methoxyphenyl)aniline; 4-methoxy-N-methyl-N-phenylbenzenamine; (4-methoxyphenyl)-methylphenylamine; N-(4-methoxyphenyl)-N-methylaniline; N-methyl-N-p-methoxyphenylaniline
Molecular FormulaC14H15NO
Molecular Weight199.25
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55251-46-2 |
| Catalog No. | 2A-9071499 |
| Chinese Name | (4-甲氧基苯基)-甲基苯胺 |
| Synonyms | 4-methoxy-n-methyl diphenylamine; N-methyl-(p-methoxyphenyl)phenylamine; N-(4-methoxyphenyl)-N-methylphenylamine; 4-methoxy-N-methyl-N-phenyl-aniline; N-methyl-N-(4-methoxyphenyl)aniline; 4-methoxy-N-methyl-N-phenylbenzenamine; (4-methoxyphenyl)-methylphenylamine; N-(4-methoxyphenyl)-N-methylaniline; N-methyl-N-p-methoxyphenylaniline |
| Molecular Formula | C14H15NO |
| Molecular Weight | 199.25 |
| HTC | 2922299090 |
| PubChem ID | 5205048 |
| SMILES | COc1ccc(N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H15NO/c1-15(12-6-4-3-5-7-12)13-8-10-14(16-2)11-9-13/h3-11H,1-2H3 |
| InChI Key | JYNABQRMIKWGTK-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-cyclohexyl-2-methylaniline | 14185-37-6 | 2A-9071492 |
| 2,6-dimethyl-N-p-tolylaniline | 24542-61-8 | 2A-9071493 |
| 2,5-dimethyl-N-phenylaniline | 32446-14-3 | 2A-9071496 |
| 2,5-dimethyl-N-p-tolylaniline | 34160-15-1 | 2A-9071497 |
| N,4-dimethyl-N-phenylaniline | 38158-65-5 | 2A-9071498 |
| Di-tert-butyl[5-bromo-3-methylpyridin-2-yl]imidodicarbonate | 497159-91-8 | 2A-9071500 |
| 4-cyclopropyl-1-fluoro-2-nitrobenzene | 769159-85-5 | 2A-9071504 |
| methyl3-bromo-2-methylbenzoate | 99548-54-6 | 2A-9071508 |
| tert-butyl6-bromopyridin-3-ylcarbamate | 218594-15-1 | 2A-9071511 |
| 6-bromo-N,N-dimethylpyridin-2-amine | 112575-13-0 | 2A-9071515 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA