
CAS Number10488-68-3
SynonymsButanoic acid, 4-chloro-3-hydroxy-, methyl ester; methyl 3-hydroxy-4-chloro-butanoate; methyl 4-chloranyl-3-oxidanyl-butanoate; methyl-4-chloro-3-hydroxy-butyrate; Methyl 4-chloro-3-hydroxybutanoate; 4-chloro-3-hydroxybutanoic acid methyl ester; 4-Chloro-3-hydroxy-butyricacidmethylester
Molecular FormulaClCH2CH(OH)CH2CO2C2H5
Molecular Weight166.60
Purity96%
Density1.2±0.1 g/cm3
Boiling Point93-95 °C/5 mmHg (lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10488-68-3 |
| Catalog No. | 2A-9071396 |
| Chinese Name | 4-氯-3-羟基丁酸甲酯 |
| Synonyms | Butanoic acid, 4-chloro-3-hydroxy-, methyl ester; methyl 3-hydroxy-4-chloro-butanoate; methyl 4-chloranyl-3-oxidanyl-butanoate; methyl-4-chloro-3-hydroxy-butyrate; Methyl 4-chloro-3-hydroxybutanoate; 4-chloro-3-hydroxybutanoic acid methyl ester; 4-Chloro-3-hydroxy-butyricacidmethylester |
| Molecular Formula | ClCH2CH(OH)CH2CO2C2H5 |
| Molecular Weight | 166.60 |
| Purity | 96 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 93-95 °C/5 mmHg (lit.) |
| Storage Condition | room temperature |
| HTC | 2918199090 |
| PubChem ID | 24869707 |
| MDL Number | MFCD00211241 |
| SMILES | CCOC(=O)C[C@H](O)CCl |
| InChI | 1S/C6H11ClO3/c1-2-10-6(9)3-5(8)4-7/h5,8H,2-4H2,1H3/t5-/m0/s1 |
| InChI Key | ZAJNMXDBJKCCAT-YFKPBYRVSA-N |
| Beilstein/REAXYS | 4657170 |
| NACRES Code | NA.22 |
| UNSPSC | 12352101 |
| MSDS | msds/71396_1_10488_68_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl-4(2-PhthalimidoEthoxy)Acetoacetate | 88150-75-8 | 2A-9071388 |
| 2-Ethyl-quinazolin-4-ol | 3137-64-2 | 2A-9071389 |
| R-(-)-5-[2-(2-Amino-2-methyl)ethyl]-2-methoxybenzenesulfonamideHCl | 112101-75-4 | 2A-9071391 |
| 2-(3-Methoxy-phenyl)-2-methyl-propionicacid | 17653-94-0 | 2A-9071392 |
| 2-(3-Methoxy-phenyl)-2-methyl-propionicacidmethylester | 32454-33-4 | 2A-9071395 |
| 2-(4-Methoxy-phenyl)-2-methyl-propionicacidmethylester | 6274-50-6 | 2A-9071398 |
| (S,Z)-5-Amino-2-(dibenzylamino)-1,6-diphenylhex-4-ene-3-one | 156732-13-7 | 2A-9071402 |
| 5-Methoxy-2-nitro-benzonitrile | 38469-84-0 | 2A-9071414 |
| 3-Methoxy-2-nitro-benzonitrile | 142596-50-7 | 2A-9071416 |
| Ethyl-3-amino-2-[(2-cyanobiphenyl-4-yl)methyl]-aminobenzoate | 136285-69-3 | 2A-9071419 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA