
CAS Number259209-20-6
SynonymsB-(5-Fluoro-2-hydroxyphenyl)boronic acid; 2-hydroxy-5-fluorophenylboronic acid; QBQR BQ EF; MFCD04115662; 2-Borono-4-fluorophenol; (5-Fluoro-2-hydroxyphenyl)boronic acid; 5-Fluoro-2-hydroxybenzeneboronic acid; 5-Fluoro-2-hydroxyphenylboronic acid
Molecular FormulaC6H6O3F1B1
Molecular Weight155.92
Density1.4±0.1 g/cm3
Boiling Point347.1±52.0 °C at 760 mmHg
Melting Point160-166°C
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 259209-20-6 |
| Catalog No. | 2A-9071378 |
| Chinese Name | 5-氟-2-羟基苯基硼酸 |
| Synonyms | B-(5-Fluoro-2-hydroxyphenyl)boronic acid; 2-hydroxy-5-fluorophenylboronic acid; QBQR BQ EF; MFCD04115662; 2-Borono-4-fluorophenol; (5-Fluoro-2-hydroxyphenyl)boronic acid; 5-Fluoro-2-hydroxybenzeneboronic acid; 5-Fluoro-2-hydroxyphenylboronic acid |
| Molecular Formula | C6H6O3F1B1 |
| Molecular Weight | 155.92 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 347.1±52.0 °C at 760 mmHg |
| Melting Point | 160-166°C |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature |
| HTC | 2931900090 |
| PubChem ID | 5329192 |
| MDL Number | MFCD03095357 |
| SMILES | OB(O)c1cc(F)ccc1O |
| InChI | InChI=1S/C6H6BFO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9-11H |
| InChI Key | TWDQSJDFXUMAOI-UHFFFAOYSA-N |
| MSDS | msds/71378_1_259209_20_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: 5-fluoro-2-hydroxyphenylboronic acid |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Bromo-6-ethoxyphenylboronicacid | 957035-13-1 | 2A-9071372 |
| 3-(hydroxymethyl)thiophen-2-yl-2-boronicacid | 222840-73-5 | 2A-9071373 |
| 2-Fluoro-3-formylphenylboronicacid | 849061-98-9 | 2A-9071375 |
| 3-(2,2,2-Trifluoroethoxy)phenylboronicacid | 850593-08-7 | 2A-9071376 |
| 4-Fluoro-3-(trifluoromethyl)phenylboronicacid | 182344-23-6 | 2A-9071377 |
| 2-Bromo-5,6-difluorophenylboronicacid | 870718-10-8 | 2A-9071379 |
| 3-Bromo-2-chlorophenylboronicacid | 352535-98-9 | 2A-9071380 |
| 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile | 171364-82-2 | 2A-9071385 |
| 4,4,5,5-tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane | 171364-83-3 | 2A-9071390 |
| 2-(4-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | 214360-65-3 | 2A-9071394 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA