
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3343-45-1 |
| Catalog No. | 2A-9071157 |
| Chinese Name | 1-(4-溴苯基)-2-羟基乙基-1-酮 |
| Synonyms | MFCD00174275; 1-(4-Bromophenyl)-2-hydroxyethan-1-one; 1-(4-bromophenyl)-2-hydroxyethanone |
| Molecular Formula | C14H10BrClO |
| Molecular Weight | 215.04400 |
| Density | 1.596g/cm3 |
| Boiling Point | 321.5ºC at 760 mmHg |
| Melting Point | 137ºC |
| HTC | 2914700090 |
| SMILES | O=C(CC1=CC=C(Br)C=C1)C2=CC=C(Cl)C=C2 |
| InChI | 1S/C14H10BrClO/c15-12-5-1-10(2-6-12)9-14(17)11-3-7-13(16)8-4-11/h1-8H,9H2 |
| InChI Key | HROHCBQZYJVQSK-UHFFFAOYSA-N |
| UNSPSC | 12352100 |
| MSDS | msds/71157_1_3343_45_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Hydroxy-2-piperidone | 19365-07-2 | 2A-9071145 |
| Tert-Butyl-N-(2-oxoethyl)cabamate | 89711-08-0 | 2A-9071147 |
| 2-methyl-benzo(d)(1,3)oxazin-4-one | 525-76-8 | 2A-9071149 |
| 2-[(2,2-Dimethyl-4,6-dioxo-[1,3]dioxan-5-ylidenemethyl)-amino]-benzoicacid | 185130-12-5 | 2A-9071150 |
| 2-Amino-cyclohex-1-enecarbonitrile | 15595-71-8 | 2A-9071156 |
| L-AsparticAcid-4-tert-Butyl-1-methylester | 2673-19-0 | 2A-9071159 |
| 5-Methyl-benzo[d]isoxazol-3-ylamine | 89976-56-7 | 2A-9071166 |
| 2,6-DimethylbenzenesulfonylChloride | 2905-29-5 | 2A-9071168 |
| 5-Methyl-1H-indazol-3-ylamine | 88805-94-1 | 2A-9071169 |
| IsopropylmagnesiumBromide | 920-39-8 | 2A-9071170 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA