
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 86225-73-2 |
| Catalog No. | 2A-9071117 |
| Chinese Name | 3-氟-2,6-二氟苯腈 |
| Synonyms | 3-Chloro-2,6-difluorobenzonitrile; NCR CG BF FF; MFCD06660172 |
| Molecular Formula | C7H2ClF2N |
| Molecular Weight | 173.55 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 198.0±35.0 °C at 760 mmHg |
| Water Solubility | Not miscible or difficult to mix with water. |
| Storage Condition | Sealed, cool, dry place |
| HTC | 2926909090 |
| PubChem ID | 29202545 |
| SMILES | N#Cc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C7H2ClF2N/c8-5-1-2-6(9)4(3-11)7(5)10/h1-2H |
| InChI Key | QYALCKFGISNFMJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-dichloro-2-hydroxybenzenesulfonylchloride | 23378-88-3 | 2A-9071106 |
| 1-Ethyl-1-methylpyrrolidiniumbromide | 69227-51-6 | 2A-9071107 |
| 4-Methoxy-3-buten-2-one | 4652-27-1 | 2A-9071108 |
| Ethyl2-aminoacetate | 459-73-4 | 2A-9071112 |
| 3-Acetylphenanthrene | 2039-76-1 | 2A-9071113 |
| L-Alanine,N-methyl-,methylesterHydrochloride | 35023-55-3 | 2A-9071119 |
| CopperTrifluoromethanethiol | 3872-23-9 | 2A-9071121 |
| Tetrabutylammoniummethoxide | 34851-41-7 | 2A-9071125 |
| 4-Bromo-2-chlorobenzonitrile | 154607-01-9 | 2A-9071132 |
| Tetrabromocatechol | 488-47-1 | 2A-9071134 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA