
CAS Number1798-04-5
SynonymsTAC acid ([4-(1,1-Dimethylethyl)phenoxy]-acetic acid; 4-tert-Butylphenoxyacetic acid; (4-tert.-Butylphenoxy)-essigsäure; (4-TERT-BUTYL-PHENOXY)-ACETIC ACID; MFCD00021758; para-t-butylphenoxyacetic acid
Molecular FormulaC12H16O3
Molecular Weight208.26
Density1.088g/cm3
Boiling Point325.4ºC at 760mmHg
Melting Point96 °C(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1798-04-5 |
| Catalog No. | 2A-9071103 |
| Chinese Name | 2-(4-(叔丁基)苯氧基)乙酸 |
| Synonyms | TAC acid ([4-(1,1-Dimethylethyl)phenoxy]-acetic acid; 4-tert-Butylphenoxyacetic acid; (4-tert.-Butylphenoxy)-essigsäure; (4-TERT-BUTYL-PHENOXY)-ACETIC ACID; MFCD00021758; para-t-butylphenoxyacetic acid |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 |
| Density | 1.088g/cm3 |
| Boiling Point | 325.4ºC at 760mmHg |
| Melting Point | 96 °C(lit.) |
| Water Solubility | Very slightly soluble (0.56 g/L) (25 ºC) |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| PubChem ID | 74176 |
| SMILES | CC(C)(C)c1ccc(OCC(O)=O)cc1 |
| InChI | InChI=1S/C12H16O3/c1-12(2,3)9-4-6-10(7-5-9)15-8-11(13)14/h4-7H,8H2,1-3H3,(H,13,14) |
| InChI Key | InChIKey=FBIGAJNVRFKBJL-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyltrans-3-ethoxyacrylate | 5941-55-9 | 2A-9071092 |
| AcetamidineBase | 143-37-3 | 2A-9071093 |
| 2-Morpholinol,6-ethyl-4-methyl- | 250244-75-8 | 2A-9071097 |
| 5-Fluoro-2-aminothiazol | 64588-82-5 | 2A-9071100 |
| 2-Pyridinamine,3-phenyl- | 87109-10-2 | 2A-9071101 |
| 3,5-dichloro-2-hydroxybenzenesulfonylchloride | 23378-88-3 | 2A-9071106 |
| 1-Ethyl-1-methylpyrrolidiniumbromide | 69227-51-6 | 2A-9071107 |
| 4-Methoxy-3-buten-2-one | 4652-27-1 | 2A-9071108 |
| Ethyl2-aminoacetate | 459-73-4 | 2A-9071112 |
| 3-Acetylphenanthrene | 2039-76-1 | 2A-9071113 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA