
CAS Number7502-06-9
Synonyms4-(hexadecyloxy)phenylamine; 4-(Hexadecyloxy)aniline; p-Hexadecyloxyaniline; 4-Hexadecyloxy-anilin; 4-n-Hexadecyloxyaniline; MFCD00025325
Molecular FormulaC22H39O1N1
Molecular Weight333.56
Density0.9±0.1 g/cm3
Boiling Point454.5±18.0 °C at 760 mmHg
Melting Point59-61ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7502-06-9 |
| Catalog No. | 2A-9071029 |
| Chinese Name | 4-十六烷氧基苯胺 |
| Synonyms | 4-(hexadecyloxy)phenylamine; 4-(Hexadecyloxy)aniline; p-Hexadecyloxyaniline; 4-Hexadecyloxy-anilin; 4-n-Hexadecyloxyaniline; MFCD00025325 |
| Molecular Formula | C22H39O1N1 |
| Molecular Weight | 333.56 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 454.5±18.0 °C at 760 mmHg |
| Melting Point | 59-61ºC |
| Storage Condition | Sealed in a cool, dry environment. |
| HTC | 2922299090 |
| PubChem ID | 473842 |
| MDL Number | MFCD00025325 |
| SMILES | CCCCCCCCCCCCCCCCOc1ccc(N)cc1 |
| InChI | InChI=1S/C22H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-24-22-18-16-21(23)17-19-22/h16-19H,2-15,20,23H2,1H3 |
| InChI Key | DETPMDIIFZGDAE-UHFFFAOYSA-N |
| MSDS | msds/71029_1_7502_06_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Nonyloxyaniline | 50262-67-4 | 2A-9071016 |
| 4-Decyloxyaniline | 39905-47-0 | 2A-9071017 |
| 4-Undecyloxyaniline | 141676-54-2 | 2A-9071024 |
| 4-Dodecyloxyaniline | 65039-19-2 | 2A-9071026 |
| 4-Tetradecyloxyaniline | 39905-46-9 | 2A-9071028 |
| 5-chloro-3-fluoropyridin-2-ol | 514797-96-7 | 2A-9071031 |
| 4-[(2,2-Dimethyl-4,6-dioxo-[1,3]dioxan-5-ylidenemethyl)-amino]-benzoicacid | 185130-11-4 | 2A-9071037 |
| 2-bromo-6-methylbenzonitrile | 77532-78-6 | 2A-9071049 |
| 2-bromo-3-methylaniline | 54879-20-8 | 2A-9071051 |
| 3-Benzoyl-2-nitrophenylaceticacid | 78940-53-1 | 2A-9071081 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA