CAS Number39905-50-5
Synonyms4-pentyloxyphenylamine; 4-n-pentoxyaniline; 4-n-pentyloxyaniline; 4-(Pentyloxy)anilin; pentyloxyaniline; 4-pentoxyphenylamine; 4-(Pentyloxy)aniline; 4-Nonyloxyaminobenzene; p-pentyloxyaniline
Molecular FormulaC11H17NO
Molecular Weight179.259
Density1.0±0.1 g/cm3
Boiling Point294.2±13.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39905-50-5 |
| Catalog No. | 2A-9071014 |
| Chinese Name | 4-戊氧基苯胺 |
| Synonyms | 4-pentyloxyphenylamine; 4-n-pentoxyaniline; 4-n-pentyloxyaniline; 4-(Pentyloxy)anilin; pentyloxyaniline; 4-pentoxyphenylamine; 4-(Pentyloxy)aniline; 4-Nonyloxyaminobenzene; p-pentyloxyaniline |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.259 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 294.2±13.0 °C at 760 mmHg |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2922299090 |
| PubChem ID | 3138693 |
| SMILES | CCCCCOc1ccc(N)cc1 |
| InChI | InChI=1S/C11H17NO/c1-2-3-4-9-13-11-7-5-10(12)6-8-11/h5-8H,2-4,9,12H2,1H3 |
| InChI Key | QZLNSNIHXKQIIS-UHFFFAOYSA-N |
| MSDS | msds/71014_1_39905_50_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Nonylaniline | 37529-29-6 | 2A-9071008 |
| 4-Undecylaniline | 57736-32-0 | 2A-9071010 |
| 4-Tetradecylaniline | 91323-12-5 | 2A-9071011 |
| 4-Hexadecylaniline | 79098-13-8 | 2A-9071012 |
| 4-Octadecylaniline | 114235-67-5 | 2A-9071013 |
| 4-Octyloxyaniline | 39905-45-8 | 2A-9071015 |
| 4-Nonyloxyaniline | 50262-67-4 | 2A-9071016 |
| 4-Decyloxyaniline | 39905-47-0 | 2A-9071017 |
| 4-Undecyloxyaniline | 141676-54-2 | 2A-9071024 |
| 4-Dodecyloxyaniline | 65039-19-2 | 2A-9071026 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS