
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 58781-08-1 |
| Catalog No. | 2A-9070995 |
| Chinese Name | 4-氧代-1,4,5,6,7,8-六氢-喹啉-3-羧酸 |
| Synonyms | 1,4,5,6,7,8-hexahydroquinolin-4-one-3-carboxylic acid; 4-Oxo-1,4,5,6,7,8-Hexahydro-Quinoline-3-Carboxylic Acid |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.19900 |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2933499090 |
| PubChem ID | 37281540 |
| SMILES | O=C(O)c1c[nH]c2c(c1=O)CCCC2 |
| InChI | InChI=1S/C10H11NO3/c12-9-6-3-1-2-4-8(6)11-5-7(9)10(13)14/h5H,1-4H2,(H,11,12)(H,13,14) |
| InChI Key | XXPUUIQPWKBEJW-UHFFFAOYSA-N |
| MSDS | msds/70995_1_58781_08_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 7-oxo-2-phenyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxylicacid | 79039-20-6 | 2A-9070977 |
| 7-benzyl-4-chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine | 192869-80-0 | 2A-9070978 |
| 6-nitro-5-(trifluoromethyl)-1H-indole | 1236060-61-9 | 2A-9070979 |
| tert-butyl5-(cyanomethyl)-1H-indole-1-carboxylate | 1255098-95-3 | 2A-9070982 |
| 4-(2-methoxyphenyl)-3-methylpiperidine | 1004852-87-2 | 2A-9070985 |
| ethyl6-amino-1H-indole-7-carboxylate | 174311-79-6 | 2A-9070997 |
| ethyl6-amino-1H-indole-5-carboxylate | 174311-74-1 | 2A-9070999 |
| 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | 610768-32-6 | 2A-9071023 |
| 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole | 885698-94-2 | 2A-9071027 |
| 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline | 1035458-54-8 | 2A-9071038 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA