
CAS Number4335-77-7
SynonymsUNII:QH762W903U; α-Cyclohexylmandelic acid; alpha-Cyclohexylmandelic acid; α-Cyclohexyl-DL-mandelic Acid; 2-Cyclohexyl-2-phenylglycolic acid; Cyclohexylphenylglycolic acid; MFCD00194543; 2-Cyclohexyl-2-hydroxy-2-phenylacetic acid; EINECS 224-380-4; Cyclohexyl(hydroxy)phenylacetic acid
Molecular FormulaC14H18O3
Molecular Weight234.29
Purity97%
Density1.2±0.1 g/cm3
Boiling Point408.6±25.0 °C at 760 mmHg
Melting Point170-175 °C
Appearancepowder
EINECS224-380-4
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4335-77-7 |
| Catalog No. | 2A-9007095 |
| Chinese Name | 2-环己基-2-羟基苯乙酸 |
| Synonyms | UNII:QH762W903U; α-Cyclohexylmandelic acid; alpha-Cyclohexylmandelic acid; α-Cyclohexyl-DL-mandelic Acid; 2-Cyclohexyl-2-phenylglycolic acid; Cyclohexylphenylglycolic acid; MFCD00194543; 2-Cyclohexyl-2-hydroxy-2-phenylacetic acid; EINECS 224-380-4; Cyclohexyl(hydroxy)phenylacetic acid |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 |
| Purity | 97 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 408.6±25.0 °C at 760 mmHg |
| Melting Point | 170-175 °C |
| Appearance | powder |
| Storage Condition | Keep away from light, ventilated and dry, sealed |
| EINECS | 224-380-4 |
| HTC | 2918199090 |
| PubChem ID | 329762637 |
| MDL Number | MFCD00194543 |
| SMILES | OC(=O)C(O)(C1CCCCC1)c2ccccc2 |
| InChI | 1S/C14H18O3/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12,17H,2,5-6,9-10H2,(H,15,16) |
| InChI Key | YTRNSQPXEDGWMR-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | Xi |
| Risk Codes | 37/38-41 |
| Safety Description | 26-39 |
| MSDS | msds/7095_1_4335_77_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Allyl ether | 557-40-4 | 2A-9007085 |
| Allylestrenol | 432-60-0 | 2A-9007086 |
| alpha-(4-Pyridyl)benzhydrol | 1620-30-0 | 2A-9007088 |
| alpha,alpha-Dimethylbenzyl chloride | 934-53-2 | 2A-9007091 |
| alpha-Bromo-2-chlorophenylacetic acid | 29270-30-2 | 2A-9007093 |
| alpha-Cyclopentylmandelic acid | 427-49-6 | 2A-9007096 |
| alpha-Ethyldeoxybenzoin | 16282-16-9 | 2A-9007097 |
| alpha-Ketoisocaproic acid | 816-66-0 | 2A-9007098 |
| Aluminum n-butoxide | 3085-30-1 | 2A-9007102 |
| Alyssin | 646-23-1 | 2A-9007103 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA