
CAS Number2267-40-5
Synonyms3-chlorosulfonyl-4-fluoro-benzoic Acid; 4-fluoro-3-chlorosulfonyl-benzoic acid; 5-Carboxy-2-fluorobenzenesulphonyl chloride; 3-(Chlorosulfonyl)-4-fluorobenzoic acid
Molecular FormulaC7H4ClFO4S
Molecular Weight238.62
Density1.67g/cm3
Boiling Point388.6ºC at 760mmHg
Melting Point147-148℃
Appearancelight brown to brown solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2267-40-5 |
| Catalog No. | 2A-9070902 |
| Chinese Name | 3-氯磺酰基-4-氟苯甲酸 |
| Synonyms | 3-chlorosulfonyl-4-fluoro-benzoic Acid; 4-fluoro-3-chlorosulfonyl-benzoic acid; 5-Carboxy-2-fluorobenzenesulphonyl chloride; 3-(Chlorosulfonyl)-4-fluorobenzoic acid |
| Molecular Formula | C7H4ClFO4S |
| Molecular Weight | 238.62 |
| Density | 1.67g/cm3 |
| Boiling Point | 388.6ºC at 760mmHg |
| Melting Point | 147-148℃ |
| Appearance | light brown to brown solid |
| Storage Condition | 2-8°C, inert gas |
| HTC | 2916399090 |
| PubChem ID | 5762568 |
| SMILES | O=C(O)c1ccc(F)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C7H4ClFO4S/c8-14(12,13)6-3-4(7(10)11)1-2-5(6)9/h1-3H,(H,10,11) |
| InChI Key | LZGZJLJZSAGDKR-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(2-Amino-ethoxy)-phenylamine | 72210-18-5 | 2A-9070885 |
| 4-(6-methoxynaphthalen-2-yl)butan-2-ol | 65726-24-1 | 2A-9070887 |
| 2-methyl-4-(trifluoromethoxy)benzenamine | 86256-59-9 | 2A-9070889 |
| [2-(1H-Indol-3-yl)-ethyl]-hydrazine | 21216-31-9 | 2A-9070894 |
| 2-(isoquinolin-6-yl)aceticacid | 1000545-64-1 | 2A-9070895 |
| N-(quinolin-4-yl)acetamide | 32433-28-6 | 2A-9070920 |
| 2-Chloro-4-methoxy-pyridin-3-ylamine | 173435-34-2 | 2A-9070926 |
| 4-methoxybutanal | 21071-24-9 | 2A-9070927 |
| 5-amino-1-methylindolin-2-one | 20870-91-1 | 2A-9070928 |
| 2-Bromo-1-(6-bromo-pyridin-3-yl)-ethanone | 136592-20-6 | 2A-9070929 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA