
CAS Number25641-99-0
SynonymsEINECS 247-159-4; α,α,α',α'-Tetrachloro-o-xylene; MFCD00000831; Benzene,1,2-bis(dichloromethyl); 1,2-Bis-dichlormethyl-benzol; o-Xylylene Tetrachloride; 1,2-bis-dichloromethyl-benzene
Molecular FormulaC8H6Cl4
Molecular Weight243.949
Purity98%
Density1.442 g/cm3
Boiling Point274 °C
Melting Point85°C
AppearanceWhite to gray white crystal powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25641-99-0 |
| Catalog No. | 2A-9007090 |
| Chinese Name | 四氯邻二甲苯 |
| Synonyms | EINECS 247-159-4; α,α,α',α'-Tetrachloro-o-xylene; MFCD00000831; Benzene,1,2-bis(dichloromethyl); 1,2-Bis-dichlormethyl-benzol; o-Xylylene Tetrachloride; 1,2-bis-dichloromethyl-benzene |
| Molecular Formula | C8H6Cl4 |
| Molecular Weight | 243.949 |
| Purity | 98 |
| Density | 1.442 g/cm3 |
| Boiling Point | 274 °C |
| Melting Point | 85°C |
| Appearance | White to gray white crystal powder |
| Storage Condition | Room Temperature |
| Packaging | III |
| HTC | 2903999090 |
| MDL Number | MFCD00018853 |
| SMILES | ClC(Cl)c1ccccc1C(Cl)Cl |
| InChI | InChI=1S/C8H6Cl4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4,7-8H |
| InChI Key | UFJYKWQUTDGGPV-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/7090_1_25641_99_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 1759 Proper shipping name: Corrosive solid, not otherwise specified Packing grade: III |
| Related Products in Industrial Applications | ||
|---|---|---|
| 6-Bromohexaneamide | 57817-55-7 | 2A-9006765 |
| 6-Bromohexanenitrile | 6621-59-6 | 2A-9006766 |
| 9-Anthracene methanol | 1468-95-7 | 2A-9007037 |
| 9-Fluorenylmethanol | 24324-17-2 | 2A-9007045 |
| alpha,alpha,alpha,alpha',alpha'-Pentachloro-2-xylene | 2741-57-3 | 2A-9007089 |
| alpha-Chloro-4-(tert-pentyl)toluene | 28162-11-0 | 2A-9007094 |
| Benzoyl-1,1,1-trifluoroacetone | 326-06-7 | 2A-9007165 |
| Bis(4-cyanophenyl)methanol | 134521-16-7 | 2A-9007243 |
| Chloropentafluoroacetone | 79-53-8 | 2A-9007395 |
| Cyclobutylmethanol | 4415-82-1 | 2A-9007452 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA