
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 135066-21-6 |
| Catalog No. | 2A-9070704 |
| Chinese Name | 4-叔丁氧基苯乙酸 |
| Synonyms | 4-tert-Butoxyphenylacetic acid |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 164.25 |
| Density | 1.093 g/cm3 |
| Boiling Point | 331.686ºC at 760 mmHg |
| HTC | 2918990090 |
| PubChem ID | 37457696 |
| SMILES | CC(C)(C)Oc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C12H16O3/c1-12(2,3)15-10-6-4-9(5-7-10)8-11(13)14/h4-7H,8H2,1-3H3,(H,13,14) |
| InChI Key | XKDCCGWJZGTHPO-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(3,4-dichlorophenyl)-N-methylacetamide | 40233-28-1 | 2A-9070694 |
| 2,2-dimethoxy-N-phenylacetamide | 881-70-9 | 2A-9070696 |
| 3-methyl-N-phenylbutanamide | 2364-50-3 | 2A-9070698 |
| DL-2-HydroxybutyricAcid | 600-15-7 | 2A-9070701 |
| Tetrafluorosuccinicacid | 377-38-8 | 2A-9070702 |
| N-(2-(1H-indol-3-yl)ethyl)-N-allylprop-2-en-1-amine | 299-89-8 | 2A-9070706 |
| 4-Morpholino-4ylmethylbenzylamine | 91271-84-0 | 2A-9070707 |
| methyl2-(3-bromophenyl)acetate | 150529-73-0 | 2A-9070708 |
| 4-hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine | 175204-69-0 | 2A-9070712 |
| 1,3-benzothiazol-5-amine | 1123-93-9 | 2A-9070716 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA