
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 36437-19-1 |
| Catalog No. | 2A-9070699 |
| Chinese Name | 2-氯马来醛 |
| Synonyms | MFCD01320489; (2Z)-2-Chloro-3-hydroxyacrylaldehyde; 2-chloropropanedial |
| Molecular Formula | C3H3ClO2 |
| Molecular Weight | 106.508 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 204.6±40.0 °C at 760 mmHg |
| Melting Point | 140-145ºC |
| Appearance | Crystalline Powder | Brown |
| Storage Condition | Sealed in a cool, dry environment at 0-6 ºC |
| HTC | 2913000090 |
| PubChem ID | 3153253 |
| SMILES | O=CC(Cl)C=O |
| InChI | InChI=1S/C3H3ClO2/c4-3(1-5)2-6/h1-2,5H/b3-1- |
| InChI Key | KTRZQCIGJUWSGE-UHFFFAOYSA-N |
| MSDS | msds/70699_1_36437_19_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| pyrimidine-4-carbohydrazide | 39513-54-7 | 2A-9070568 |
| 6-(trifluoromethyl)pyrazin-2-amine | 69816-35-9 | 2A-9070592 |
| 3-(bromomethyl)-Benzenamine | 130462-63-4 | 2A-9070597 |
| [3-[(Pyrrolidin-1-yl)carbonyl]phenyl]boronicacid | 723281-53-6 | 2A-9070657 |
| Benzenamine,4-[4-(trifluoromethyl)phenoxy]- | 57478-19-0 | 2A-9070673 |
| 3,5-difluoro-4-(trifluoromethyl)bromobenzene | 156243-64-0 | 2A-9070705 |
| Ethyl3-oxocyclohexanecarboxylate | 33668-25-6 | 2A-9070711 |
| 2-Chloro-3-cyanobenzaldehyde | 165187-24-6 | 2A-9070713 |
| thiazole-2-carbohydrazide | 16733-90-7 | 2A-9070727 |
| Thiazole-4-carboxylicacidhydrazide | 101257-38-9 | 2A-9070730 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA