
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 172366-38-0 |
| Catalog No. | 2A-9070599 |
| Chinese Name | 5,7-二氟-3,4-二氢萘-2(1H)-酮 |
| Synonyms | 5,7-difluoro-2-tetralone; 5,7-DF2T; 5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-one |
| Molecular Formula | C10H8O1F2 |
| Molecular Weight | 182.17 |
| Density | 1.29g/cm3 |
| Boiling Point | 260.6ºC at 760mmHg |
| Storage Condition | 2-8°C |
| HTC | 2914700090 |
| PubChem ID | 4954968 |
| MDL Number | MFCD03788446 |
| SMILES | O=C1CCc2c(F)cc(F)cc2C1 |
| InChI | InChI=1S/C10H8F2O/c11-7-3-6-4-8(13)1-2-9(6)10(12)5-7/h3,5H,1-2,4H2 |
| InChI Key | HOUVATQQKYAEBB-UHFFFAOYSA-N |
| MSDS | msds/70599_1_172366_38_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-(aminomethyl)pyridin-2(1H)-one | 131052-62-5 | 2A-9070576 |
| 1-Pyridin-4-yl-ethylamine | 50392-78-4 | 2A-9070577 |
| 2-Bromo-1-phenylpropane | 2114-39-8 | 2A-9070578 |
| quinoxalin-5-amine | 16566-20-4 | 2A-9070595 |
| 5,7-Difluoro-1,2,3,4-tetrahydro-naphthalen-1-ylamine | 907973-46-0 | 2A-9070596 |
| N-(4-Methoxy-3-nitrophenyl)acetamide | 50651-39-3 | 2A-9070604 |
| L-Glucono-1,5-lactone | 52153-09-0 | 2A-9070607 |
| tert-butyl2-hydroxy-3-methylbutanoate | 2528-17-8 | 2A-9070608 |
| tert-butyl3-hydroxypropylmethylcarbamate | 98642-44-5 | 2A-9070618 |
| 6-bromo-2-chloroquinazolin-4(3H)-one | 167158-70-5 | 2A-9070621 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA