
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 317830-83-4 |
| Catalog No. | 2A-9070516 |
| Chinese Name | 苯并呋喃-3-硼酸 |
| Synonyms | benzofuran-3-ylboronic acid; Benzofuran-3-boronic Acid; 1-Benzofuran-3-ylboronic acid |
| Molecular Formula | C8H7BO3 |
| Molecular Weight | 161.95 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 340.4±34.0 °C at 760 mmHg |
| Appearance | Solid;White to Light yellow powder to crystal |
| Water Solubility | Very slightly soluble: methanol |
| Storage Condition | room temperature, dry |
| PubChem ID | 46205809 |
| SMILES | OB(O)c1coc2ccccc12 |
| InChI | InChI=1S/C8H7BO3/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5,10-11H |
| InChI Key | DFUGYZQSDFQVPU-UHFFFAOYSA-N |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified Benzofuran-3-boronic acid (with varying amounts of anhydride) |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-Pyrrolidineacetamide,N-(5-methyl-3-isoxazolyl)- | 666821-88-1 | 2A-9070503 |
| N-(BOC)-7-fluoroindole-2-boronicacid | 1000068-65-4 | 2A-9070507 |
| Carbamicacid,(5-methyl-3-isoxazolyl)-,ethylester(9CI) | 92087-97-3 | 2A-9070508 |
| 2-(2-Amino-5-Bromobenzoyl)pyridine | 1563-56-0 | 2A-9070509 |
| 3-methyl-2-Thiophenemethanol | 63826-56-2 | 2A-9070510 |
| 4-Pyridinesulfonicacid | 5402-20-0 | 2A-9070519 |
| 2,5-Dibromopyridine-4-carboxylicacid | 942473-59-8 | 2A-9070524 |
| 2-Bromo-4H-furo[3,2-b]pyrrole-5-carboxylicacidethylester | 80709-83-7 | 2A-9070525 |
| oxazole-4-carbothioamide | 118802-31-6 | 2A-9070526 |
| 3,5-Dibromopyridine-4-carboxylicacid | 13958-91-3 | 2A-9070527 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA