CAS Number22027-51-6
Synonyms3-Oxo-3-p-tolyl-propionicacidmethylester; Benzenepropanoic acid, 4-methyl-β-oxo-, methyl ester; Methyl 3-(4-methylphenyl)-3-oxopropanoate; methyl 3-oxo-3-p-tolylpropanoate; methyl 4-methylbenzoylacetate
Molecular FormulaC11H12O3
Molecular Weight192.21
Density1.1±0.1 g/cm3
Boiling Point276.1±15.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22027-51-6 |
| Catalog No. | 2A-9070436 |
| Chinese Name | 3-氧代-3-(对甲苯基)丙酸甲酯 |
| Synonyms | 3-Oxo-3-p-tolyl-propionicacidmethylester; Benzenepropanoic acid, 4-methyl-β-oxo-, methyl ester; Methyl 3-(4-methylphenyl)-3-oxopropanoate; methyl 3-oxo-3-p-tolylpropanoate; methyl 4-methylbenzoylacetate |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 276.1±15.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2918300090 |
| PubChem ID | 434770 |
| SMILES | COC(=O)CC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H12O3/c1-8-3-5-9(6-4-8)10(12)7-11(13)14-2/h3-6H,7H2,1-2H3 |
| InChI Key | BIKPAXOCIFGWRJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| methyl3-(chlorocarbonyl)benzoate | 3441-03-0 | 2A-9070420 |
| Benzoicacid,4-[1-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)ethenyl]-,methylester | 153559-48-9 | 2A-9070421 |
| 5-bromonaphthalene-2-carboxylicacid | 1013-83-8 | 2A-9070423 |
| dimethocaine | 94-15-5 | 2A-9070426 |
| 5-chloropyrimidin-4-amine | 101257-82-3 | 2A-9070434 |
| methyl4-(2-aminoethyl)benzoate | 77265-67-9 | 2A-9070441 |
| Methyl(4-chlorobenzoyl)acetate | 22027-53-8 | 2A-9070442 |
| 2-Sulfo-1,4-benzenedicarboxylicAcid1,4-DimethylEsterSodiumSalt | 31314-30-4 | 2A-9070444 |
| 6-chloro-3-methylpicolinonitrile | 1201924-31-3 | 2A-9070445 |
| (2,2-dimethyl-1-propyl)benzene | 1007-26-7 | 2A-9070448 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS