
CAS Number4524-77-0
SynonymsPhenol,2-bromo-4,6-dichloro; 6-BROMO-2,4-DICHLOROPHENOL; 4.6-Dichlor-2-brom-1-hydroxy-benzol; 2-Brom-4,6-dichlor-phenol; 2,4-dichloro-6-bromophenol; 2-bromo-4,6-dichloro-phenol
Molecular FormulaC6H3BrCl2O
Molecular Weight241.89700
Density1.89g/cm3
Boiling Point239.6ºC at 760 mmHg
Melting Point67-69ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4524-77-0 |
| Catalog No. | 2A-9070407 |
| Chinese Name | 2,6-二氯-4-溴苯酚 |
| Synonyms | Phenol,2-bromo-4,6-dichloro; 6-BROMO-2,4-DICHLOROPHENOL; 4.6-Dichlor-2-brom-1-hydroxy-benzol; 2-Brom-4,6-dichlor-phenol; 2,4-dichloro-6-bromophenol; 2-bromo-4,6-dichloro-phenol |
| Molecular Formula | C6H3BrCl2O |
| Molecular Weight | 241.89700 |
| Density | 1.89g/cm3 |
| Boiling Point | 239.6ºC at 760 mmHg |
| Melting Point | 67-69ºC |
| Storage Condition | room temperature |
| HTC | 2908199090 |
| PubChem ID | 403460 |
| SMILES | Oc1c(Cl)cc(Cl)cc1Br |
| InChI | InChI=1S/C6H3BrCl2O/c7-4-1-3(8)2-5(9)6(4)10/h1-2,10H |
| InChI Key | FRPHJINKMDMSPH-UHFFFAOYSA-N |
| MSDS | msds/70407_1_4524_77_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cumylamine | 585-32-0 | 2A-9070376 |
| 5-Aminomethyl-1H-pyridin-2-one | 131052-84-1 | 2A-0202100 |
| 2-Pyridylaceticacidmethylester | 1658-42-0 | 2A-9070382 |
| 5-fluorobenzo[d]isoxazol-3-amine | 868271-13-0 | 2A-9070392 |
| Methyl2,6-dichloroisonicotinate | 42521-09-5 | 2A-9070402 |
| Diisopropylsulfite | 4773-13-1 | 2A-9070414 |
| 3-Hydroxy-2-piperidone | 19365-08-3 | 2A-9070417 |
| 4-Chlorobenzene-sulfonmethyl-ester | 15481-45-5 | 2A-9070418 |
| 4-(2-Methoxyphenyl)heptane-3,5-dione | 20730-58-9 | 2A-9070419 |
| methyl3-(chlorocarbonyl)benzoate | 3441-03-0 | 2A-9070420 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA