
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5336-90-3 |
| Catalog No. | 2A-9007040 |
| Chinese Name | 9-羧基吖啶 |
| Synonyms | MFCD00009734; Acridine-9-carboxylic acid; 9-Acridinecarboxylic acid |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.227 |
| Purity | 97 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 480.4±18.0 °C at 760 mmHg |
| Melting Point | 290 °C (dec.)(lit.) |
| Storage Condition | Keep away from light, cool and dry place, sealed a |
| HTC | 2933990090 |
| SMILES | O=C(O)c1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C14H9NO2/c16-14(17)13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H,16,17) |
| InChI Key | IYRYQBAAHMBIFT-UHFFFAOYSA-N |
| MSDS | msds/7040_1_5336_90_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 8-Cyclopentyl-1,3-dimethylxanthine | 35873-49-5 | 2A-9007020 |
| 9,10-Bis(phenylethynyl)anthracene | 10075-85-1 | 2A-9007032 |
| 9,10-Diphenylanthracene | 1499-10-1 | 2A-9007034 |
| 9,10-Phenanthrenequinone | 84-11-7 | 2A-9007035 |
| 9-Bromofluorene | 1940-57-4 | 2A-9007039 |
| 9-Chloro-1,2,3,4-tetrahydroacridine | 5396-30-5 | 2A-9007041 |
| 9-Chlorocarbonylacridine | 66074-67-7 | 2A-9007042 |
| 9H-Hexadecafluorononanoic acid | 76-21-1 | 2A-9007046 |
| 9H-Hexadecafluorononanoyl chloride | 423-95-0 | 2A-9007047 |
| Abz-Gly-4-Nitro-Phe-Pro-OH | 67482-93-3 | 2A-9007051 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA