
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4122-54-7 |
| Catalog No. | 2A-9070387 |
| Chinese Name | 1-丁酰咪唑 |
| Synonyms | 1-imidazol-1-ylbutan-1-one; MFCD00191892 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.16700 |
| Density | 1.086 g/mL at 25ºC(lit.) |
| Boiling Point | 247.4ºC at 760 mmHg |
| Storage Condition | Store in airtight, cool and dry place |
| HTC | 2933290090 |
| PubChem ID | 840436 |
| SMILES | CCCC(=O)n1ccnc1 |
| InChI | InChI=1S/C7H10N2O/c1-2-3-7(10)9-5-4-8-6-9/h4-6H,2-3H2,1H3 |
| InChI Key | FRBJFEASMICLGH-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| methyl1H-indazole-6-carboxylate | 170487-40-8 | 2A-9070379 |
| methyl2-aminooxazole-5-carboxylate | 934236-40-5 | 2A-9070383 |
| 2-bromo-1H-imidazole-4,5-dicarbonitrile | 50847-09-1 | 2A-9070384 |
| methyl2-bromo-5-methylthiophene-3-carboxylate | 944709-72-2 | 2A-9070385 |
| 2-Bromo-5-(cyanomethyl)pyridine | 144873-99-4 | 2A-9070386 |
| methyl2-bromothiazole-4-carboxylate | 170235-26-4 | 2A-9070388 |
| 4-Hydroxy-7,8-dimethoxyquinoline | 99878-76-9 | 2A-9070389 |
| methyl2-chlorooxazole-5-carboxylate | 934236-41-6 | 2A-9070390 |
| 4-Amino-2-methylquinoline | 6628-04-2 | 2A-9070391 |
| 5-aminopyrrolo[3,2-b]pyridine | 20526-69-6 | 2A-9070393 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA