
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 75476-78-7 |
| Catalog No. | 2A-9070345 |
| Chinese Name | 5-溴-1H-茚 |
| Synonyms | 5-Bromo-1H-indene; 1H-Indene,5-bromo; 5-Bromoindene; 6-bromo-indene |
| Molecular Formula | C9H7Br |
| Molecular Weight | 195.06 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 245.0±29.0 °C at 760 mmHg |
| Melting Point | 41ºC |
| Appearance | colorless |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2903999090 |
| PubChem ID | 3172185 |
| SMILES | Brc1ccc2c(c1)C=CC2 |
| InChI | InChI=1S/C9H7Br/c10-9-5-4-7-2-1-3-8(7)6-9/h1,3-6H,2H2 |
| InChI Key | ZPZKSAJLIFPVSR-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2-Benzenedicarboxylicacid,diheptylester | 3648-21-3 | 2A-9070333 |
| 5-Bromo-6-fluoronicotinicacid | 29241-63-2 | 2A-9070335 |
| 3-Isopropenyl-6-oxoheptanal | 7086-79-5 | 2A-9070338 |
| 3-Nitro-N,N-diethylaniline | 2216-16-2 | 2A-9070340 |
| L-threo-Hexaricacid,2,5-anhydro-3,4-dideoxy | 81370-94-7 | 2A-9070341 |
| 4-Acetyl-4-(ethoxycarbonyl)heptanedioicacid | 72653-14-6 | 2A-9070353 |
| 4-(tert-Butyl)benzene-1,2-diamine | 68176-57-8 | 2A-9070358 |
| 4-Amino-3-ethylbenzoicacid | 51688-75-6 | 2A-9070366 |
| 3-(Benzyloxy)aniline | 1484-26-0 | 2A-9070372 |
| Cumylamine | 585-32-0 | 2A-9070376 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA