
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61047-43-6 |
| Catalog No. | 2A-9070343 |
| Chinese Name | 8-溴-2-甲基喹啉 |
| Synonyms | 8-Bromo-2-methylquinoline |
| Molecular Formula | C10H8BrN |
| Molecular Weight | 222.08 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 299.7±20.0 °C at 760 mmHg |
| Melting Point | 63-65ºC |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | room temperature |
| HTC | 2933499090 |
| PubChem ID | 6960452 |
| SMILES | Cc1ccc2cccc(Br)c2n1 |
| InChI | InChI=1S/C10H8BrN/c1-7-5-6-8-3-2-4-9(11)10(8)12-7/h2-6H,1H3 |
| InChI Key | GQPRZSFQSOEDNV-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-chloro-3-fluoropyridine-2-carboxylicacid | 207994-08-9 | 2A-9070322 |
| isoquinoline-8-carbonitrile | 362606-11-9 | 2A-9070323 |
| isothiazole-5-carbaldehyde | 5242-57-9 | 2A-9070327 |
| 5-Hydroxy-3-methylindole | 1125-40-2 | 2A-9070336 |
| Methyl3-amino-5-(4-chlorophenyl)thiophene-2-carboxylate | 91076-93-6 | 2A-9070337 |
| 2,5-Dibromo-3-octylthiophene | 149703-84-4 | 2A-9070344 |
| 5-chloro-3-methylpyridine-2-carboxylicacid | 886365-46-4 | 2A-9070346 |
| 5-Bromobenzo[b]thiophene-3-carboxylicacid | 7312-24-5 | 2A-9070348 |
| methyl1-(4-(trifluoromethyl)phenyl)-5-(4-(methylthio)phenyl)-1H-pyrazole-3-carboxylate | 641639-55-6 | 2A-9070350 |
| 5-Chloropyrimidine-2-Carbonitrile | 38275-56-8 | 2A-9070351 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA