![Bexaroteneintermediate3,Benzoicacid,4-[(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)carbonyl]-,methylester structure, CAS 153559-45-6](/structures/80000/70315_1_153559_45_6.png)
CAS Number153559-45-6
SynonymsMethyl 4-[(3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydro-2-naphthalenyl)carbonyl]benzoate; Methyl [4-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)carbonyl]benzoate; QC-1728; methyl 4-[(3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydro-2-naphthyl)carbonyl]benzoate; Benzoic acid, 4-[(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)carbonyl]-, methyl ester; Methyl 4-(3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalene-2-carbonyl)benzoate
Molecular FormulaC24H28O3
Molecular Weight364.48
Density1.1±0.1 g/cm3
Boiling Point472.8±45.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 153559-45-6 |
| Catalog No. | 2A-9070315 |
| Chinese Name | 4-(3,5,5,8,8-五甲基-5,6,7,8-四氢萘-2-羰基)苯甲酸甲酯 |
| Synonyms | Methyl 4-[(3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydro-2-naphthalenyl)carbonyl]benzoate; Methyl [4-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)carbonyl]benzoate; QC-1728; methyl 4-[(3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydro-2-naphthyl)carbonyl]benzoate; Benzoic acid, 4-[(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)carbonyl]-, methyl ester; Methyl 4-(3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalene-2-carbonyl)benzoate |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.48 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 472.8±45.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2918300090 |
| PubChem ID | 16831833 |
| SMILES | COC(=O)c1ccc(C(=O)c2cc3c(cc2C)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C24H28O3/c1-15-13-19-20(24(4,5)12-11-23(19,2)3)14-18(15)21(25)16-7-9-17(10-8-16)22(26)27-6/h7-10,13-14H,11-12H2,1-6H3 |
| InChI Key | DYVLPJYIGJZAKF-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| MSDS | msds/70315_1_153559_45_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methylpicolinicacid | 4021-08-3 | 2A-9070305 |
| 2-Methoxy-4-methylbenzenesulfonylchloride | 216394-11-5 | 2A-9070307 |
| ElaidicAcid | 112-79-8 | 2A-9070310 |
| Benzoicacid,4-[(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)carbonyl]- | 153559-46-7 | 2A-9070311 |
| 2,3,4,6-Tetramethyl-D-glucose | 7506-68-5 | 2A-9070313 |
| (1E)-2-cyano-2-[4-(1,1-dimethylethyl)phenyl]-1-(1,3,4-trimethyl-1H-pyrazol-5-yl)ethenyl2,2-dimethylpropanoate | 560121-52-0 | 2A-9070316 |
| Methyl[[2-chloro-5-[(1E)-1-[[(6-methyl-2-pyridinyl)methoxy]imino]ethyl]phenyl]methyl]carbamate | 799247-52-2 | 2A-9070318 |
| 4-Nitroacetanilide | 104-04-1 | 2A-9070325 |
| 4-Fluoro-3-nitrophenylaceticacid | 192508-32-4 | 2A-9070326 |
| 3-Nitroacetanilide | 122-28-1 | 2A-9070328 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA