
CAS Number243666-11-7
Synonyms4-Amino-7-trifluoromethylquinoline; 7-(trifluoromethyl)quinolin-4-amine; 4-AMINO-7-(TRIFLUOROMETHYL)QUINOLINE; 7-trifluoromethyl-quinolin-4-ylamine; 7-(Trifluoromethyl)-4-quinolinamine; MFCD00269411
Molecular FormulaC10H7F3N2
Molecular Weight212.17
Density1.4±0.1 g/cm3
Boiling Point329.7±37.0 °C at 760 mmHg
Melting Point104 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 243666-11-7 |
| Catalog No. | 2A-9070260 |
| Chinese Name | 4-氨基-7-(三氟甲基)喹啉 |
| Synonyms | 4-Amino-7-trifluoromethylquinoline; 7-(trifluoromethyl)quinolin-4-amine; 4-AMINO-7-(TRIFLUOROMETHYL)QUINOLINE; 7-trifluoromethyl-quinolin-4-ylamine; 7-(Trifluoromethyl)-4-quinolinamine; MFCD00269411 |
| Molecular Formula | C10H7F3N2 |
| Molecular Weight | 212.17 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 329.7±37.0 °C at 760 mmHg |
| Melting Point | 104 °C |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2933499090 |
| PubChem ID | 3158814 |
| SMILES | Nc1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C10H7F3N2/c11-10(12,13)6-1-2-7-8(14)3-4-15-9(7)5-6/h1-5H,(H2,14,15) |
| InChI Key | QZOOIAOULGJTJI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-Pyridinecarboximidamide | 23255-20-1 | 2A-9070253 |
| 5-bromo-4-methoxy-1H-indazole | 850363-67-6 | 2A-9070254 |
| 5-bromo-4-methyl-1H-indazole | 1082041-34-6 | 2A-9070256 |
| 3,4,5-Trichloropyridazine | 14161-11-6 | 2A-9070257 |
| 5-bromo-4-methylisoquinoline | 651310-24-6 | 2A-9070259 |
| 5-bromo-6-methyl-1H-indazole | 885223-72-3 | 2A-9070261 |
| 4-Bromopyridine-3-carboxaldehyde | 154105-64-3 | 2A-9070262 |
| 5-bromo-7-methyl-1H-indazole | 1146637-09-3 | 2A-9070264 |
| 5-bromo-8-chloroisoquinoline | 956003-79-5 | 2A-9070266 |
| ethyl6-bromo-1H-indazole-3-carboxylate | 885272-94-6 | 2A-9070267 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA