
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 32778-35-1 |
| Catalog No. | 2A-9070194 |
| Chinese Name | 3-二甲胺甲基-3-丁烯-2-酮 |
| Synonyms | 2-dimethylaminomethyl-1-buten-3-one; 3-Dimethylaminomethyl-3-buten-2-on; 3-Dimethylaminomethyl-but-3-en-2-on; 3-dimethylaminomethyl-but-3-en-2-one |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.18400 |
| Density | 0.887 g/cm3 |
| Boiling Point | 172.309ºC at 760 mmHg |
| HTC | 2922399090 |
| PubChem ID | 62651082 |
| SMILES | C=C(CN(C)C)C(C)=O |
| InChI | InChI=1S/C7H13NO/c1-6(7(2)9)5-8(3)4/h1,5H2,2-4H3 |
| InChI Key | SIMWBLBMZJOMID-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-bromo-1H-indazol-3-amine | 61272-71-7 | 2A-9070169 |
| ethyl3-nitropropanoate | 590-37-2 | 2A-9070186 |
| Octahydronaphthalene-1,5-Dione | 13913-82-1 | 2A-9070190 |
| 4-Chlorobenzamidinehydriodide | 115297-57-9 | 2A-9070192 |
| (R)(+)Dichlorophenylaminoalcohol | 135936-36-6 | 2A-9070193 |
| 3-mercapto-1-hexanolacetate | 136954-20-6 | 2A-9070196 |
| Dichlorophenylaminoalcohol | 152298-51-6 | 2A-9070200 |
| (S)(-)Dichlorophenylaminoalcohol | 160707-16-4 | 2A-9070205 |
| 5-bromo-2-methylphenol | 36138-76-8 | 2A-9070208 |
| Methylbromo(4-fluorophenyl)acetate | 72191-41-4 | 2A-9070239 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA