
CAS Number18706-22-4
Synonyms8-Chloro-2-(trifluoromethyl)quinolin-4-ol; MFCD00276589; 8-Chloro-4-hydroxy-2-(trifluoromethyl)quinoline
Molecular FormulaC10H5ClF3NO
Molecular Weight247.61
Purity97%
Density1.499g/cm3
Boiling Point258.6ºC at 760mmHg
Melting Point138 °C
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18706-22-4 |
| Catalog No. | 2A-9007017 |
| Chinese Name | 8-氯-4-羟基-2-(三氟甲基)喹啉 |
| Synonyms | 8-Chloro-2-(trifluoromethyl)quinolin-4-ol; MFCD00276589; 8-Chloro-4-hydroxy-2-(trifluoromethyl)quinoline |
| Molecular Formula | C10H5ClF3NO |
| Molecular Weight | 247.61 |
| Purity | 97 |
| Density | 1.499g/cm3 |
| Boiling Point | 258.6ºC at 760mmHg |
| Melting Point | 138 °C |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Closed at room temperature, protected from light, |
| HTC | 2933499090 |
| MDL Number | MFCD00276589 |
| SMILES | O=c1cc(C(F)(F)F)[nH]c2c(Cl)cccc12 |
| InChI Key | SBVZSZNYPRWWNN-UHFFFAOYSA-N |
| MSDS | msds/7017_1_18706_22_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 8-Amino-6-methoxyquinoline | 90-52-8 | 2A-9007004 |
| 8-Aminoquinoline | 578-66-5 | 2A-9007006 |
| 8-Azaadenine | 1123-54-2 | 2A-9007007 |
| 8-Bromoisoquinoline | 63927-22-0 | 2A-9007012 |
| 8-Bromoquinoline | 16567-18-3 | 2A-9007014 |
| 8-Ethoxycarbonyl-6-methoxy-7-methylpyrrolo[2,3-e]benzofurazan-3-oxide | 257869-86-6 | 2A-9007022 |
| 8-Hydroxyquinoline | 148-24-3 | 2A-9007024 |
| 8-Hydroxyquinoline-N-oxide | 1127-45-3 | 2A-9007025 |
| 8-Mercaptoquinoline hydrochloride | 34006-16-1 | 2A-9007027 |
| 8-Methylquinoline | 611-32-5 | 2A-9007028 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA