CAS Number1528-42-3
SynonymsEthyl (4-acetylphenyl)acetate; Ethyl 4-acetylphenylacetate; ethyl p-acetylphenylacetate; Ethyl-(4-acetylphenyl)acetat; para-acetyl-phenylacetic acid ethyl ester; Benzeneacetic acid, 4-acetyl-, ethyl ester
Molecular FormulaC10H10O3
Molecular Weight178.189
Density1.1±0.1 g/cm3
Boiling Point315.5±25.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1528-42-3 |
| Catalog No. | 2A-9070125 |
| Chinese Name | 2-(4-乙酰基苯基)乙酸乙酯 |
| Synonyms | Ethyl (4-acetylphenyl)acetate; Ethyl 4-acetylphenylacetate; ethyl p-acetylphenylacetate; Ethyl-(4-acetylphenyl)acetat; para-acetyl-phenylacetic acid ethyl ester; Benzeneacetic acid, 4-acetyl-, ethyl ester |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.189 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 315.5±25.0 °C at 760 mmHg |
| HTC | 2918300090 |
| PubChem ID | 8195841 |
| MDL Number | MFCD00017229 |
| SMILES | CCOC(=O)Cc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C12H14O3/c1-3-15-12(14)8-10-4-6-11(7-5-10)9(2)13/h4-7H,3,8H2,1-2H3 |
| InChI Key | UYKWAZSTKGYKOG-UHFFFAOYSA-N |
| MSDS | msds/70125_1_1528_42_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(6-Bromo-pyridin-2-yl)-3-methyl-benzoicacid | 1020718-68-6 | 2A-9070117 |
| 4-(6-Chloro-pyrazin-2-yl)-3-methyl-benzoicacid | 1020718-71-1 | 2A-9070120 |
| ethyl2-(4-(aminomethyl)phenyl)acetatehydrochloride | 17841-69-9 | 2A-9070122 |
| 3,4-dihydro-7-methoxy-4-oxoquinazolin-6-ylacetate | 179688-53-0 | 2A-9070123 |
| 4-(6-Chloro-pyrazin-2-yl)-2-methyl-benzoicacid | 1020718-74-4 | 2A-9070124 |
| 4-(3-chloro-4-fluorophenylamino)-7-methoxyquinazolin-6-ylacetate.HCL | 184475-70-5 | 2A-9070127 |
| 4-(3-chloro-4-fluorophenylamino)-7-methoxyquinazolin-6-ol | 184475-71-6 | 2A-9070130 |
| ethyl2-(benzo[d]thiazol-2-yl)acetate | 29182-42-1 | 2A-9070137 |
| ethyl3,4-bis(2-methoxyethoxy)benzoate | 183322-16-9 | 2A-9070138 |
| ethyl4,5-bis(2-methoxyethoxy)-2-aminobenzoate | 179688-27-8 | 2A-9070140 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS