
CAS Number5467-70-9
Synonyms4-methylphenacylamine hydrochloride; 2-Amino-1-p-tolyl-aethanon,Hydrochlorid; Ethanone, 2-amino-1-(4-methylphenyl)-, hydrochloride (1:1); 2-(4-Methylphenyl)-2-oxoethanaminiumchlorid; 2-Amino-1-P-Tolyl-Ethanone Hydrochloride; 2-(4-Methylphenyl)-2-oxoethanaminium chloride; 2-Amino-1-(4-methylphenyl)ethanone hydrochloride (1:1); p-Methylphenacylamine hydrochloride
Molecular FormulaC9H12ClNO
Molecular Weight154.14
Purity≥97 (CP)%
Density1.058g/cm3
Boiling Point272.6ºC at 760mmHg
Melting Point220ºC (dec.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5467-70-9 |
| Catalog No. | 2A-9070086 |
| Chinese Name | 4-甲基-α-氨基苯乙酮盐酸盐 |
| Synonyms | 4-methylphenacylamine hydrochloride; 2-Amino-1-p-tolyl-aethanon,Hydrochlorid; Ethanone, 2-amino-1-(4-methylphenyl)-, hydrochloride (1:1); 2-(4-Methylphenyl)-2-oxoethanaminiumchlorid; 2-Amino-1-P-Tolyl-Ethanone Hydrochloride; 2-(4-Methylphenyl)-2-oxoethanaminium chloride; 2-Amino-1-(4-methylphenyl)ethanone hydrochloride (1:1); p-Methylphenacylamine hydrochloride |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 154.14 |
| Purity | ≥97 (CP) |
| Density | 1.058g/cm3 |
| Boiling Point | 272.6ºC at 760mmHg |
| Melting Point | 220ºC (dec.) |
| Appearance | solid |
| Storage Condition | Store at room temperature, away from light, in a c |
| HTC | 2922399090 |
| PubChem ID | 542517 |
| SMILES | O=[13C](OC)C1=NC=CC([15NH2])=C1 |
| InChI | InChI=1S/C9H11NO.Cl/c1-7-2-4-8(5-3-7)9(11)6-10;/h2-5H,6,10H2,1H3; |
| InChI Key | IHWOUORJQZGRRF-UHFFFAOYSA-N |
| UNSPSC | 12352200 |
| MSDS | msds/70086_1_5467_70_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4.4-Dimethyl-3.5.8-Trioxabic-yclo(5.1.0)octane | 57280-22-5 | 2A-9070078 |
| 2-s-Thiuroniumethanesulfonate | 25958-57-3 | 2A-9070080 |
| 4,6-O-Ethylidene-2,3-di-o-chloroacetyl-β-D-glucopyranose | 149403-65-6 | 2A-9070081 |
| but-3-enylchloroformate | 8986-45-2 | 2A-9070082 |
| α-Amino-4’-bromoacetophenonehydrochloride | 5467-72-1 | 2A-9070084 |
| cyclohexylmethanesulfonylchloride | 4352-30-1 | 2A-9070087 |
| α-Amino-4’-methoxyacetophenonehydrochloride | 3883-94-1 | 2A-9070088 |
| dibutylcarbamicchloride | 13358-73-1 | 2A-9070089 |
| Diethyl(carboxymethylamino)methylenemalonate | 54132-81-9 | 2A-9070090 |
| D-Proline,4-hydroxy-,methylester,(4S) | 178962-09-9 | 2A-9070094 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA