
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 256935-86-1 |
| Catalog No. | 2A-9070064 |
| Chinese Name | 6-氯-1H-吲哚-5-羧酸 |
| Synonyms | 6-chloro-5-indole carboxylic acid; 1H-Indole-5-carboxylicacid,6-chloro; 5-carboxylic-6-chloro indole acid; 6-chloroindole-5-carboxylic acid; QC-9758 |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.6 |
| Boiling Point | 434.4±25.0°C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933990090 |
| PubChem ID | 39655914 |
| SMILES | O=C(O)c1cc2cc[nH]c2cc1Cl |
| InChI | InChI=1S/C9H6ClNO2/c10-7-4-8-5(1-2-11-8)3-6(7)9(12)13/h1-4,11H,(H,12,13) |
| InChI Key | PNQNYTQRGUBNTG-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-(bromomethyl)-1-methyl-1H-indazole | 1092961-02-8 | 2A-9070059 |
| 5-(bromomethyl)-2-methoxypyridine | 128632-03-1 | 2A-9070060 |
| 6-Bromo-5-methyl-1H-indazole | 1000343-69-0 | 2A-9070061 |
| 5-(bromomethyl)isoquinoline | 158654-74-1 | 2A-9070062 |
| 5-(trifluoromethyl)-1H-benzo[d]imidazole-2-carboxylicacid | 2107-39-3 | 2A-9070063 |
| 5-(trifluoromethyl)-3-hydroxythiophene-2-carboxylicacid | 217959-85-8 | 2A-9070065 |
| Isoindoline-5-carboxylicacid | 685084-08-6 | 2A-9070067 |
| 5-(trifluoromethyl)pyridine-3-carbaldehyde | 131747-67-6 | 2A-9070068 |
| 5-amino-1H-indazole-7-carboxylicacid | 885272-13-9 | 2A-9070071 |
| 5-Bromo-4-hydroxypyrimidine | 19808-30-1 | 2A-9070072 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA