CAS Number238754-67-1
SynonymsMFCD00236303; 2-[3-Fluoro-4-(trifluoromethyl)phenyl]acetic acid; [3-Fluoro-4-(trifluoromethyl)phenyl]acetic acid; 3-Fluoro-4-(trifluoromethyl)benzeneacetic acid; QV1R CF DXFFF; 3-Fluoro-4-(trifluoromethyl)phenylacetic acid
Molecular FormulaC9H6O2F4
Molecular Weight222.14
Density1.4±0.1 g/cm3
Boiling Point266.6±35.0 °C at 760 mmHg
Melting Point88-90°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 238754-67-1 |
| Catalog No. | 2A-9069725 |
| Chinese Name | 3-氟-4-(三氟甲基)苯乙酸 |
| Synonyms | MFCD00236303; 2-[3-Fluoro-4-(trifluoromethyl)phenyl]acetic acid; [3-Fluoro-4-(trifluoromethyl)phenyl]acetic acid; 3-Fluoro-4-(trifluoromethyl)benzeneacetic acid; QV1R CF DXFFF; 3-Fluoro-4-(trifluoromethyl)phenylacetic acid |
| Molecular Formula | C9H6O2F4 |
| Molecular Weight | 222.14 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 266.6±35.0 °C at 760 mmHg |
| Melting Point | 88-90°C |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2916399090 |
| MDL Number | MFCD00236303 |
| SMILES | O=C(O)Cc1ccc(C(F)(F)F)c(F)c1 |
| InChI Key | ZFOWDXKJQNNLMW-UHFFFAOYSA-N |
| MSDS | msds/69725_1_238754_67_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Chloro-2-fluoro-6-(trifluoromethyl)phenylacetonitrile | 261763-16-0 | 2A-9069685 |
| 2-cyclohexylethylboronicacid | 105869-43-0 | 2A-9069686 |
| 2-Fluoro-4-(trifluoromethyl)phenylacetonitrile | 239087-11-7 | 2A-9069693 |
| 3,5-Bis(trifluoromethyl)-4-chlorobenzonitrile | 62584-30-9 | 2A-9069703 |
| 2-Methyl-5-(trifluoromethyl)benzonitrile | 261952-03-8 | 2A-9069714 |
| 3-Fluoro-5-(trifluoromethyl)phenylacetonitrile | 239087-12-8 | 2A-9069726 |
| 4-Fluoro-3-(trifluoromethyl)phenylaceticacid | 220227-47-4 | 2A-9069727 |
| 3-(bromomethyl)phenol | 74597-04-9 | 2A-9069760 |
| 3-(cyclopropylmethoxy)phenylboronicacid | 411229-76-0 | 2A-9069762 |
| 3-(trifluoromethyl)benzamidinehydrochloride | 62980-03-4 | 2A-9069767 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS