
CAS Number4403-36-5
Synonyms2-(Phthalimido)ethanesulfonyl chloride; MFCD01861217; 2-Phthalimidoethanesulfonyl chloride; 2-(1,3-dioxoisoindol-2-yl)ethanesulfonyl chloride; 2-(1,3-Dioxoisoindolin-2-yl)ethanesulfonylchloride
Molecular FormulaC10H8ClNO4S
Molecular Weight273.697
Density1.585g/cm3
Boiling Point416.5ºC at 760mmHg
Melting Point158-163ºC
AppearanceSolid;White to Light yellow powder to crystal
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4403-36-5 |
| Catalog No. | 2A-9069718 |
| Chinese Name | 2-苯二甲酰亚氨基乙烷磺酰氯 |
| Synonyms | 2-(Phthalimido)ethanesulfonyl chloride; MFCD01861217; 2-Phthalimidoethanesulfonyl chloride; 2-(1,3-dioxoisoindol-2-yl)ethanesulfonyl chloride; 2-(1,3-Dioxoisoindolin-2-yl)ethanesulfonylchloride |
| Molecular Formula | C10H8ClNO4S |
| Molecular Weight | 273.697 |
| Density | 1.585g/cm3 |
| Boiling Point | 416.5ºC at 760mmHg |
| Melting Point | 158-163ºC |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | 2-8°C |
| Packaging | II |
| HTC | 2925190090 |
| MDL Number | MFCD01861217 |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)Cl |
| InChI | InChI=1S/C10H8ClNO4S/c11-17(15,16)6-5-12-9(13)7-3-1-2-4-8(7)10(12)14/h1-4H,5-6H2 |
| InChI Key | HCPVYBCAYPMANM-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/69718_1_4403_36_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Fluoro-2-methoxybenzonitrile | 191014-55-8 | 2A-9069710 |
| 2-Fluoro-3-methylbenzonitrile | 185147-07-3 | 2A-9069711 |
| 2-Fluoro-6-methylbenzonitrile | 198633-76-0 | 2A-9069712 |
| 2-Nitro-5-(trifluoromethoxy)benzonitrile | 1003708-58-4 | 2A-9069715 |
| 2-phenylthiazol-4-amine | 66787-75-5 | 2A-9069717 |
| 2-tosylaceticacid | 3937-96-0 | 2A-9069721 |
| 2-vinylbenzenamine | 3867-18-3 | 2A-9069722 |
| 3-(1H-1,2,4-triazol-1-yl)propan-1-aminehydrochloride | 69807-82-5 | 2A-9069723 |
| 3-(2-chlorophenyl)propan-1-amine | 18655-48-6 | 2A-9069724 |
| 2-(4-methyl-1,3-thiazol-2-yl)acetonitrile | 19785-39-8 | 2A-9069729 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA