CAS Number177952-39-5
SynonymsFXFFR B1VQ EXFFF; 2,4-ditrifluoromethylphenylacetic acid; 2,3-DIMETHYL-6-ETHYL-PYRAZINE; [2,4-Bis(trifluoromethyl)phenyl]acetic acid; 2,4-Bis(trifluoromethyl)benzeneacetic acid; MFCD00042492; 2,4-Bis(trifluoromethyl)phenylacetic acid
Molecular FormulaC10H6O2F6
Molecular Weight272.15
Density1.5±0.1 g/cm3
Boiling Point235.1±35.0 °C at 760 mmHg
Melting Point33-35 °C(lit.)
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 177952-39-5 |
| Catalog No. | 2A-9069653 |
| Chinese Name | 2,4-双(三氟甲基)苯乙酸 |
| Synonyms | FXFFR B1VQ EXFFF; 2,4-ditrifluoromethylphenylacetic acid; 2,3-DIMETHYL-6-ETHYL-PYRAZINE; [2,4-Bis(trifluoromethyl)phenyl]acetic acid; 2,4-Bis(trifluoromethyl)benzeneacetic acid; MFCD00042492; 2,4-Bis(trifluoromethyl)phenylacetic acid |
| Molecular Formula | C10H6O2F6 |
| Molecular Weight | 272.15 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 235.1±35.0 °C at 760 mmHg |
| Melting Point | 33-35 °C(lit.) |
| Appearance | white powder |
| Water Solubility | soluble |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2916399090 |
| MDL Number | MFCD00042492 |
| SMILES | O=C(O)Cc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H6F6O2/c11-9(12,13)6-2-1-5(3-8(17)18)7(4-6)10(14,15)16/h1-2,4H,3H2,(H,17,18) |
| InChI Key | BCHGLBXVODTIEE-UHFFFAOYSA-N |
| MSDS | msds/69653_1_177952_39_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-carbamoylphenylboronicacid | 380430-54-6 | 2A-9069641 |
| 4-Fluoro-2-methoxybenzaldehyde | 450-83-9 | 2A-9069642 |
| 2-Fluoro-3-methylbenzaldehyde | 886762-64-7 | 2A-9069643 |
| 3-Fluoro-5-methylbenzaldehyde | 189628-39-5 | 2A-9069646 |
| 2-Fluoro-5-(trifluoromethyl)benzaldehyde | 886497-81-0 | 2A-9069650 |
| 2-chloro-6-hydroxybenzaldehyde | 18362-30-6 | 2A-9069661 |
| 3-Chloro-2-fluoro-6-(trifluoromethyl)phenylacetonitrile | 261763-16-0 | 2A-9069685 |
| 2-cyclohexylethylboronicacid | 105869-43-0 | 2A-9069686 |
| 2-Fluoro-4-(trifluoromethyl)phenylacetonitrile | 239087-11-7 | 2A-9069693 |
| 3,5-Bis(trifluoromethyl)-4-chlorobenzonitrile | 62584-30-9 | 2A-9069703 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS