
CAS Number519054-55-8
SynonymsBenzofuran-5-boronic acid pinacol ester; 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran
Molecular FormulaC14H17BO3
Molecular Weight244.094
Density1.1±0.1 g/cm3
Boiling Point340.0±15.0 °C at 760 mmHg
Melting Point72ºC
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 519054-55-8 |
| Catalog No. | 2A-9069539 |
| Chinese Name | 苯并呋喃-5-硼酸频哪醇酯 |
| Synonyms | Benzofuran-5-boronic acid pinacol ester; 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran |
| Molecular Formula | C14H17BO3 |
| Molecular Weight | 244.094 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 340.0±15.0 °C at 760 mmHg |
| Melting Point | 72ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature |
| HTC | 2934999090 |
| SMILES | CC1(C)OB(c2ccc3occc3c2)OC1(C)C |
| InChI Key | ZQCCCOMKYKVFFN-UHFFFAOYSA-N |
| MSDS | msds/69539_1_519054_55_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Fluoro-5-(trifluoromethyl)benzylalcohol | 184970-29-4 | 2A-9069513 |
| 4-Fluoro-2-(trifluoromethyl)benzylalcohol | 220227-29-2 | 2A-9069514 |
| 4-Fluoro-3-(trifluoromethyl)benzylbromide | 184970-26-1 | 2A-9069515 |
| 4-Methoxy-3-(trifluoromethyl)benzylbromide | 261951-89-7 | 2A-9069517 |
| 3,5-Bis(trifluoromethyl)phenylethanol | 368-63-8 | 2A-9069525 |
| 2-Methyl-4-(trifluoromethyl)aniline | 67169-22-6 | 2A-9069543 |
| 2,2,2-trifluoroacetaldehydehydrate | 33953-86-5 | 2A-9069567 |
| 2-Fluoro-5-(trifluoromethyl)phenol | 141483-15-0 | 2A-9069594 |
| 5-Fluoro-2-(trifluoromethyl)phenol | 243459-91-8 | 2A-9069595 |
| 2,6-difluoro-3-hydroxyphenylboronicacid | 957065-86-0 | 2A-9069596 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA