
CAS Number493024-39-8
SynonymsGR CF E1E; MFCD03788472; 1-(Bromomethyl)-3-chloro-5-fluorobenzene; 3-Chloro-5-fluorobenzyl bromide
Molecular FormulaC7H5BrClF
Molecular Weight223.470
Density1.7±0.1 g/cm3
Boiling Point219.1±25.0 °C at 760 mmHg
Melting Point25-30ºC
AppearanceWhite to light yellow crystal powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 493024-39-8 |
| Catalog No. | 2A-9069467 |
| Chinese Name | 3-氯-5-氟苄基溴 |
| Synonyms | GR CF E1E; MFCD03788472; 1-(Bromomethyl)-3-chloro-5-fluorobenzene; 3-Chloro-5-fluorobenzyl bromide |
| Molecular Formula | C7H5BrClF |
| Molecular Weight | 223.470 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 219.1±25.0 °C at 760 mmHg |
| Melting Point | 25-30ºC |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Sealed, cool, dry place |
| Packaging | III |
| HTC | 2903999090 |
| SMILES | Fc1cc(Cl)cc(CBr)c1 |
| InChI | InChI=1S/C7H5BrClF/c8-4-5-1-6(9)3-7(10)2-5/h1-3H,4H2 |
| InChI Key | PKSAHOPFPPAUOD-UHFFFAOYSA-N |
| Hazard Symbols | Category 8 |
| MSDS | msds/69467_1_493024_39_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3265 Proper shipping name: Corrosive Liquid, Acidic, Organic, Not Otherwise Specified Packing grade: II |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Bromo-2-chlorobenzylalcohol | 149965-40-2 | 2A-9069457 |
| 4-Bromo-2,6-difluorobenzylalcohol | 162744-59-4 | 2A-9069459 |
| 3-Bromo-5-fluorobenzylalcohol | 216755-56-5 | 2A-0202284 |
| 3-(tert-Butylamino)-1-chloro-2-propanolhydrochloride | 41052-94-2 | 2A-9069464 |
| 2-((benzyloxy)carbonyl)aceticacid | 53439-79-5 | 2A-9069465 |
| 2-(1H-1,2,4-triazol-1-yl)ethanamine | 51444-31-6 | 2A-9069468 |
| 2-(1H-benzo[d]imidazol-1-yl)ethanamine | 112947-93-0 | 2A-9069469 |
| 2-(1H-imidazol-5-yl)ethanamine | 65592-96-3 | 2A-9069471 |
| 2-(1H-indazol-3-yl)aceticacid | 6663-42-3 | 2A-9069472 |
| 2-(1H-indol-7-yl)ethanamine | 46007-12-9 | 2A-9069473 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA