CAS Number127817-85-0
SynonymsQVR DO1 BXFFF; 4-Methoxy-2-(trifluoromethyl)benzoic acid; 2-(Trifluoromethyl)-p-anisic acid; α,α,α-Trifluoro-4-methoxy-o-toluic acid; MFCD01091013
Molecular FormulaC9H7O3F3
Molecular Weight220.15
Density1.4±0.1 g/cm3
Boiling Point274.8±40.0 °C at 760 mmHg
Melting Point147-150°C
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 127817-85-0 |
| Catalog No. | 2A-9069430 |
| Chinese Name | 4-甲氧基-2-三氟甲基苯甲酸 |
| Synonyms | QVR DO1 BXFFF; 4-Methoxy-2-(trifluoromethyl)benzoic acid; 2-(Trifluoromethyl)-p-anisic acid; α,α,α-Trifluoro-4-methoxy-o-toluic acid; MFCD01091013 |
| Molecular Formula | C9H7O3F3 |
| Molecular Weight | 220.15 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 274.8±40.0 °C at 760 mmHg |
| Melting Point | 147-150°C |
| Appearance | white powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2918990090 |
| MDL Number | MFCD01091013 |
| SMILES | COc1ccc(C(=O)O)c(C(F)(F)F)c1 |
| InChI Key | MLCRFQSWSHKLDP-UHFFFAOYSA-N |
| MSDS | msds/69430_1_127817_85_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Fluoro-5-(trifluoromethyl)benzoicacid | 115029-23-7 | 2A-9069418 |
| 2-Fluoro-6-(trifluoromethyl)benzoicacid | 32890-94-1 | 2A-9069421 |
| 3-Fluoro-4-(trifluoromethyl)benzoicacid | 115754-21-7 | 2A-9069424 |
| 4-Fluoro-2-(trifluoromethyl)benzoicacid | 141179-72-8 | 2A-9069426 |
| 1-methyl-1H-indol-5-yl-5-boronicacid | 192182-55-1 | 2A-9069427 |
| 4-(Trifluoromethoxy)cinnamicaldehyde | 183800-94-4 | 2A-9069446 |
| 1-Methylcyclohexanecarboxaldehyde | 6140-64-3 | 2A-9069454 |
| 1-Oxa-8-aza-spiro[4.5]decan-2-one;hydrochloride | 374794-92-0 | 2A-9069460 |
| 1-Oxa-8-azaspiro[4.5]decane,hydrochloride | 3970-79-4 | 2A-9069461 |
| 3-Chloro-2-fluoro-5-(trifluoromethyl)benzylalcohol | 261763-05-7 | 2A-9069470 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS