
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2142-06-5 |
| Catalog No. | 2A-9069321 |
| Chinese Name | N-苄基琥珀酰亚胺 |
| Synonyms | N-benzyl-succinimide; 1-benzylsuccinimide; 1-benzyl-pyrrolidine-2,5-dione; N-Benzylmaleimide; N-Phenylmethyl succinimide |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.216 |
| Density | 1.252g/cm3 |
| Boiling Point | 394.5ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2925190090 |
| MDL Number | MFCD00516834 |
| SMILES | O=C1CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C11H11NO2/c13-10-6-7-11(14)12(10)8-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChI Key | IONNJVQITCVNHK-UHFFFAOYSA-N |
| MSDS | msds/69321_1_2142_06_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-aminoisoquinoline-7-carbonitrile | 215454-25-4 | 2A-9069314 |
| 1-aminoisoquinoline-7-carboxylicacid | 221050-71-1 | 2A-9069316 |
| 1-benzylazetidine-2-carboxamide | 40432-40-4 | 2A-9069318 |
| 1-benzylpiperidine-4-carboxylicacid | 10315-07-8 | 2A-9069319 |
| 2-Bromo-6-methylpyrazine | 914452-71-4 | 2A-9069320 |
| 3,5-Dichloro-4-pyridinecarbonitrile | 153463-65-1 | 2A-9069325 |
| 3-(Trifluoromethyl)-1H-pyrazole-4-carbaldehyde | 1001020-14-9 | 2A-9069328 |
| 1-Chloroisoquinoline-5-carboxylicacid | 763068-68-4 | 2A-9069329 |
| 1-chloroisoquinoline-7-carbaldehyde | 223671-53-2 | 2A-9069330 |
| 3-Methoxy-1H-pyrazole-4-carbaldehyde | 1215632-94-2 | 2A-9069331 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA