
CAS Number50597-88-1
Synonyms2-Iodo-4-methylphenyl methyl ether; 2-Iodo-1-methoxy-4-methylbenzene; 3-Iodo-4-methoxytoluene
Molecular FormulaC8H9O1I1
Molecular Weight248.06
Density1.6±0.1 g/cm3
Boiling Point257.6±28.0 °C at 760 mmHg
Melting Point28-30ºC
Appearancelight brown to brown crystals
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50597-88-1 |
| Catalog No. | 2A-9069260 |
| Chinese Name | 3-碘-4-甲氧基甲苯 |
| Synonyms | 2-Iodo-4-methylphenyl methyl ether; 2-Iodo-1-methoxy-4-methylbenzene; 3-Iodo-4-methoxytoluene |
| Molecular Formula | C8H9O1I1 |
| Molecular Weight | 248.06 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 257.6±28.0 °C at 760 mmHg |
| Melting Point | 28-30ºC |
| Appearance | light brown to brown crystals |
| Storage Condition | -20℃, avoid light |
| HTC | 2909309090 |
| MDL Number | MFCD00060660 |
| SMILES | COc1ccc(C)cc1I |
| InChI | InChI=1S/C8H9IO/c1-6-3-4-8(10-2)7(9)5-6/h3-5H,1-2H3 |
| InChI Key | OASGOCIPNQWXLR-UHFFFAOYSA-N |
| MSDS | msds/69260_1_50597_88_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2,3-Dihydro-1,4-benzodioxin-6-methanol | 39270-39-8 | 2A-9069253 |
| 3-Trifluoromethoxytoluene | 705-44-2 | 2A-9069256 |
| 4-Bromo-2-chloro-3-fluorotoluene | 909122-21-0 | 2A-9069257 |
| 4-Bromo-2-fluoro-5-iodotoluene | 202865-74-5 | 2A-9069258 |
| 2-Bromo-4-fluoro-6-nitrotoluene | 502496-33-5 | 2A-9069259 |
| 3-Iodo-4-nitrotoluene | 52488-29-6 | 2A-9069261 |
| 2,3,5-Trifluorotoluene | 132992-29-1 | 2A-9069262 |
| 2,3,4,5-Tetrafluorotoluene | 21622-19-5 | 2A-9069288 |
| 2-(1H-pyrazol-4-yl)ethanol | 180207-57-2 | 2A-9069478 |
| 2-(4-bromo-1H-pyrazol-1-yl)ethanol | 214614-81-0 | 2A-9069511 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA