
CAS Number2369-37-1
Synonyms1,2-Dibromo-4-fluorobenzene; 3,4-Dibromo-1-fluorobenzene; 3,4-DIBROMOFLUOROBENZENE; 1,2,-dibromo-4-fluorobenzene; MFCD00070780; 1,2-Dibrom-4-fluor-benzol; EINECS 219-131-1; 1,2-Dibromo-4-fluorobenzol
Molecular FormulaC6H3Br2F1
Molecular Weight253.9
Purity99%
Density2.0±0.1 g/cm3
Boiling Point219.7±20.0 °C at 760 mmHg
Melting Point162-164°C
AppearanceTransparent colorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2369-37-1 |
| Catalog No. | 2A-9000692 |
| Chinese Name | 1,2-二溴-4-氟苯 |
| Synonyms | 1,2-Dibromo-4-fluorobenzene; 3,4-Dibromo-1-fluorobenzene; 3,4-DIBROMOFLUOROBENZENE; 1,2,-dibromo-4-fluorobenzene; MFCD00070780; 1,2-Dibrom-4-fluor-benzol; EINECS 219-131-1; 1,2-Dibromo-4-fluorobenzol |
| Molecular Formula | C6H3Br2F1 |
| Molecular Weight | 253.9 |
| Purity | 99 |
| Density | 2.0±0.1 g/cm3 |
| Boiling Point | 219.7±20.0 °C at 760 mmHg |
| Melting Point | 162-164°C |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Keep container tightly closed and stored in a cool |
| HTC | 2903999090 |
| MDL Number | MFCD00070780 |
| SMILES | Fc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C6H3Br2F/c7-5-2-1-4(9)3-6(5)8/h1-3H |
| InChI Key | RNTGKISRXVFIIP-UHFFFAOYSA-N |
| MSDS | msds/692_1_2369_37_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2-Diamino-3,4-difluorobenzene | 153505-39-6 | 2A-9000686 |
| 1,2-Diamino-4,5-dichlorobenzene | 5348-42-5 | 2A-9000687 |
| 1,2-Dibromo-3,3,3-trifluoropropane | 431-21-0 | 2A-9000689 |
| 1,2-Dibromo-3,3,3-trifluoropropene | 431-22-1 | 2A-9000690 |
| 1,2-Dibromo-4,5-difluorobenzene | 64695-78-9 | 2A-9000691 |
| 1,2-Dibromohexafluorocyclobutane | 377-40-2 | 2A-9000693 |
| 1,2-Dibromotetrafluorobenzene | 827-08-7 | 2A-9000694 |
| 1,2-Dicarbonitrile-4,5-dichloro-3,6-dioxo-1,4-cyclohexadiene | 84-58-2 | 2A-9000695 |
| 1,2-Dichloro-1,1-difluoroethane | 1649-08-7 | 2A-9000697 |
| 1,2-Dichloro-1,2-difluoroethane | 431-06-1 | 2A-9000698 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA