
CAS Number30934-97-5
Synonyms2,2-Dimethoxyethanol; EINECS 250-398-7; GLYCOLALDEHYDE DIMETHYL ACETAL; glycol aldehyde dimethyl acetal; Ethanol,2,2-dimethoxy; Glycolaldehydedimethylacetal; 2,2-Dimethoxy-ethanol; dimethoxy ethanol; Hydroxyacetaldehyde Dimethylacetal; MFCD00051799
Molecular FormulaC4H10O3
Molecular Weight106.122
Density1.0±0.1 g/cm3
Boiling Point146.1±20.0 °C at 760 mmHg
Melting Point<-76ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30934-97-5 |
| Catalog No. | 2A-9069191 |
| Chinese Name | 羟基乙醛二甲基缩醛 |
| Synonyms | 2,2-Dimethoxyethanol; EINECS 250-398-7; GLYCOLALDEHYDE DIMETHYL ACETAL; glycol aldehyde dimethyl acetal; Ethanol,2,2-dimethoxy; Glycolaldehydedimethylacetal; 2,2-Dimethoxy-ethanol; dimethoxy ethanol; Hydroxyacetaldehyde Dimethylacetal; MFCD00051799 |
| Molecular Formula | C4H10O3 |
| Molecular Weight | 106.122 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 146.1±20.0 °C at 760 mmHg |
| Melting Point | <-76ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2911000000 |
| MDL Number | MFCD00051799 |
| SMILES | COC(CO)OC |
| InChI | InChI=1S/C4H10O3/c1-6-4(3-5)7-2/h4-5H,3H2,1-2H3 |
| InChI Key | NYPNCQTUZYWFGG-UHFFFAOYSA-N |
| MSDS | msds/69191_1_30934_97_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2911000000 acetals and hemiacetals, whether or not with other oxygen function, and their halogenated, sulphonated, nitrated or nitrosated derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 3,4Dibromotoluene | 660956-23-2 | 2A-9069182 |
| 2,6-Dichloro-3-nitrotoluene | 29682-46-0 | 2A-9069184 |
| 2,6-Dichloro-4-nitrotoluene | 7149-69-1 | 2A-9069185 |
| 3,4-Dichloro-6-nitrotoluene | 7494-45-3 | 2A-9069188 |
| 3-Fluoro-2-iodotoluene | 883502-14-5 | 2A-9069190 |
| 3-Fluoro-2-nitrotoluene | 3013-27-2 | 2A-9069193 |
| 5-Chloro-2-iodotoluene | 23399-70-4 | 2A-9069194 |
| 4-Cyano-2,6-difluorotoluene | 170572-50-6 | 2A-9069197 |
| 4-Chloro-2-fluoro-5-nitrotoluene | 18349-11-6 | 2A-9069201 |
| 2-Chloro-5-iodotoluene | 116632-41-8 | 2A-9069205 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA