CAS Number14237-71-9
Synonyms2-Chloro-3-cyano-4,6-dimethylpyridine; 2-Chloro-4,6-dimethylnicotinonitrile; MFCD00051676; 2-Chloro-4,6-dimethyl-3-pyridinecarbonitrile; 2-Chloro-4,6-dimethylpyridine-3-carbonitrile
Molecular FormulaC8H6N2Cl1Br1
Molecular Weight245.51
Density1.2±0.1 g/cm3
Boiling Point305.3±37.0 °C at 760 mmHg
Melting Point98-99°C
AppearanceWhite to yellowish brown solid, powder, crystal and/or large block
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14237-71-9 |
| Catalog No. | 2A-9069164 |
| Chinese Name | 2-氯-3-氰基-4,6-二甲基吡啶 |
| Synonyms | 2-Chloro-3-cyano-4,6-dimethylpyridine; 2-Chloro-4,6-dimethylnicotinonitrile; MFCD00051676; 2-Chloro-4,6-dimethyl-3-pyridinecarbonitrile; 2-Chloro-4,6-dimethylpyridine-3-carbonitrile |
| Molecular Formula | C8H6N2Cl1Br1 |
| Molecular Weight | 245.51 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 305.3±37.0 °C at 760 mmHg |
| Melting Point | 98-99°C |
| Appearance | White to yellowish brown solid, powder, crystal and/or large block |
| Storage Condition | Sealed at room temperature, protected from light, |
| Packaging | III |
| HTC | 2933399090 |
| MDL Number | MFCD03791216 |
| SMILES | Cc1cc(C)c(C#N)c(Cl)n1 |
| InChI | InChI=1S/C8H7ClN2/c1-5-3-6(2)11-8(9)7(5)4-10/h3H,1-2H3 |
| InChI Key | RETJKTAVEQPNMH-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/69164_1_14237_71_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Item 1 Poisons. UN number: 3439 Proper shipping name: Nitrile, Solid, Toxic, Not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-fluoro-2-methylacetophenone | 29427-49-4 | 2A-9069157 |
| 4-Chloro-N-hydroxybenzenecarboximidamide | 5033-28-3 | 2A-9069158 |
| 3-Bromo-4-fluorobenzylbromide | 78239-71-1 | 2A-9069159 |
| 2,4,6-Trifluorobenzotrifluoride | 122030-04-0 | 2A-9069161 |
| 3-Amino-4-(methylamino)benzonitrile | 64910-46-9 | 2A-9069162 |
| 3,5-Difluorobenzylamine | 90390-27-5 | 2A-9069165 |
| 3-Amino-5-bromobenzoicacid | 42237-85-4 | 2A-9069169 |
| 2-(Trifluoromethoxy)benzylamine | 175205-64-8 | 2A-9069171 |
| 3-(Trifluoromethoxy)benzylamine | 93071-75-1 | 2A-9069174 |
| 4-(Trifluoromethoxy)benzylamine | 93919-56-3 | 2A-9069179 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS