
CAS Number208173-21-1
Synonyms1-(4-Fluoro-2-(trifluoromethyl)phenyl)ethanone; FXFFR CF FV1; 1-acetyl-4-fluoro-2-(trifluoromethyl)benzene; MFCD00061252; 1-[4-fluoro-2-(trifluoromethyl)phenyl]ethan-1-one; 1-[4-Fluoro-2-(trifluoromethyl)phenyl]ethanone
Molecular FormulaC9H6F4O
Molecular Weight206.137
Purity95%
Density1.3±0.1 g/cm3
Boiling Point211.8±40.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 208173-21-1 |
| Catalog No. | 2A-9069154 |
| Chinese Name | 4-氟-2-(三氟甲基)苯乙酮 |
| Synonyms | 1-(4-Fluoro-2-(trifluoromethyl)phenyl)ethanone; FXFFR CF FV1; 1-acetyl-4-fluoro-2-(trifluoromethyl)benzene; MFCD00061252; 1-[4-fluoro-2-(trifluoromethyl)phenyl]ethan-1-one; 1-[4-Fluoro-2-(trifluoromethyl)phenyl]ethanone |
| Molecular Formula | C9H6F4O |
| Molecular Weight | 206.137 |
| Purity | 95 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 211.8±40.0 °C at 760 mmHg |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2914700090 |
| SMILES | CC(=O)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H6F4O/c1-5(14)7-3-2-6(10)4-8(7)9(11,12)13/h2-4H,1H3 |
| InChI Key | WBCCAINPZLAKRN-UHFFFAOYSA-N |
| MSDS | msds/69154_1_208173_21_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1-Chloromethyl-5-nitronaphthalene | 6625-54-3 | 2A-9069082 |
| 2-Amino-6-trifluoromethylbenzoicacid | 314-46-5 | 2A-9069116 |
| 2-(3-Trifluoromethylphenyl)ethylamine | 52516-30-0 | 2A-9069119 |
| 3-Hydroxy-4-iodobenzaldehyde | 135242-71-6 | 2A-9069125 |
| 1-(Bromomethyl)-3-phenoxybenzene | 51632-16-7 | 2A-9069134 |
| 3,5-Bis(trifluoromethyl)benzylamine | 42365-62-8 | 2A-9069163 |
| 2-Fluoro-5-(trifluoromethyl)benzylamine | 199296-61-2 | 2A-9069168 |
| 3-Bromo-5-(trifluoromethyl)toluene | 86845-28-5 | 2A-9069207 |
| Ethyl-1-methylcyclopropanecarboxylate | 71441-76-4 | 2A-9069246 |
| 7-(Chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine | 67869-70-9 | 2A-9069255 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA