
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 402-12-0 |
| Catalog No. | 2A-9069150 |
| Chinese Name | 3-氟-4-硝基三氟甲苯 |
| Synonyms | 3-Fluoro-4-nitro-benzotrifluoride; 2-Fluoro-1-nitro-4-(trifluoromethyl)benzene |
| Molecular Formula | FC6H3(NO2)CF3 |
| Molecular Weight | 209.10 |
| Purity | 96 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 92 °C/15 mmHg (lit.) |
| Appearance | liquid |
| Storage Condition | 2-8°C, dry and sealed |
| EINECS | 206-702-5 |
| HTC | 2904909090 |
| PubChem ID | 24861423 |
| MDL Number | MFCD00007059 |
| SMILES | [O-][N+](=O)c1cc(ccc1F)C(F)(F)F |
| InChI | 1S/C7H3F4NO2/c8-5-2-1-4(7(9,10)11)3-6(5)12(13)14/h1-3H |
| InChI Key | HLDFCCHSOZWKAA-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1880508 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/69150_1_402_12_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dichlorobenzylchloride | 3290-06-0 | 2A-9069142 |
| 5-Chloronicotinitrile | 51269-82-0 | 2A-9069143 |
| 4-Cyano-3-fluorobenzoicacid | 176508-81-9 | 2A-9069146 |
| 2-Fluoro-4-nitrobenzotrifluoride | 6911-67-2 | 2A-9069148 |
| 2-Fluoro-5-formylbenzoicacid | 550363-85-4 | 2A-9069149 |
| 1,2-Diamino-4-chloro-5-methylbenzene | 63155-04-4 | 2A-9069151 |
| 4-Fluorophthalonitrile | 65610-14-2 | 2A-9069152 |
| 4-Iodo-3-nitrobenzotrifluoride | 400-97-5 | 2A-9069153 |
| 2-(4-Chlorophenoxy)-2-methylpropanoylchloride | 5542-60-9 | 2A-9069155 |
| 2-Methoxy-4-methyl-5-nitrobenzotrifluoride | 933673-45-1 | 2A-9069156 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA