![7,7-Dichlorobicyclo[3.2.0]hept-2-ene-6-one structure, CAS 5307-99-3](/structures/20000/6911_1_5307_99_3.png)
CAS Number5307-99-3
SynonymsEINECS 226-165-0; MFCD00013738; 7,7-dichlorobicyclo(3.2.0)hept-2-en-6-one; 7,7-DICHLOROBICYCLO[3.2.0]HEPT-2-EN-6-ONE; 6,6-dichlorobicyclo[3.2.0]hept-3-en-7-one
Molecular FormulaC7H6O1Cl2
Molecular Weight177.03
Purity97%
Density1.4±0.1 g/cm3
Boiling Point274.8±35.0 °C at 760 mmHg
AppearanceTransparent brown liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5307-99-3 |
| Catalog No. | 2A-9006911 |
| Chinese Name | 7,7-二氯二环[3.2.0]庚-2-烯-6-酮 |
| Synonyms | EINECS 226-165-0; MFCD00013738; 7,7-dichlorobicyclo(3.2.0)hept-2-en-6-one; 7,7-DICHLOROBICYCLO[3.2.0]HEPT-2-EN-6-ONE; 6,6-dichlorobicyclo[3.2.0]hept-3-en-7-one |
| Molecular Formula | C7H6O1Cl2 |
| Molecular Weight | 177.03 |
| Purity | 97 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 274.8±35.0 °C at 760 mmHg |
| Appearance | Transparent brown liquid |
| Storage Condition | Store at 4℃ away from light, in a cool and dry pla |
| HTC | 2914700090 |
| MDL Number | MFCD00013738 |
| SMILES | O=C1C2CC=CC2C1(Cl)Cl |
| InChI | InChI=1S/C7H6Cl2O/c8-7(9)5-3-1-2-4(5)6(7)10/h1,3-5H,2H2 |
| InChI Key | JBPBARAOHIDZPU-UHFFFAOYSA-N |
| MSDS | msds/6911_1_5307_99_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 6-Trifluoromethylindole | 13544-43-9 | 2A-9006903 |
| 6-Trifluoromethylindoline | 181513-29-1 | 2A-9006904 |
| 6-Trifluoromethyloxindole | 1735-89-3 | 2A-9006906 |
| 7-(4-Ethyl-1-methyloctyl)-8-hydroxyquinoline | 73545-11-6 | 2A-9006909 |
| 7-(4-Nitrophenyl)-3H-thieno[3,2-d]pyrimidin-4-one | 2A-106910 | 2A-9006910 |
| 7-Amino-1,2,3,4-tetrahydro-1-methylquinoline | 304690-94-6 | 2A-9006916 |
| 7-Amino-1,2,3,4-tetrahydroquinoline | 153856-89-4 | 2A-9006917 |
| 7-Amino-1-ethyl-1,2,3,4-tetrahydroquinoline | 2A-106918 | 2A-9006918 |
| 7-Amino-3-methyl-8-oxo-5-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid | 26395-99-3 | 2A-9006921 |
| 7-Amino-8-oxo-3-vinyl-5-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid | 2A-106926 | 2A-9006926 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA