
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 116965-16-3 |
| Catalog No. | 2A-9068873 |
| Chinese Name | 3-硝基-4-(三氟甲基)苯甲酸 |
| Synonyms | 3-Nitro-4-(trifluoromethyl)benzoic acid; MFCD00274359 |
| Molecular Formula | C8H4F3NO4 |
| Molecular Weight | 235.117 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 330.0±42.0 °C at 760 mmHg |
| Melting Point | 169ºC |
| Appearance | White to light yellow crystal powder |
| Storage Condition | room temperature, dry |
| HTC | 2916399090 |
| SMILES | O=C(O)c1ccc(C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI Key | NIWGMOJIGTUDFT-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Bromo-5-(trifluoromethyl)benzylalcohol | 875664-30-5 | 2A-9068795 |
| 3-Methyl-4-nitrobenzaldehyde | 18515-67-8 | 2A-9068806 |
| 2-Amino-4-fluorobenzaldehyde | 152367-89-0 | 2A-9068840 |
| 2,5-Dibromobenzaldehyde | 891180-59-9 | 2A-9068863 |
| 2-Bromo-5-(trifluoromethyl)benzylbromide | 875664-32-7 | 2A-9068866 |
| 3-Trifluoromethyl-4-aminobenzoicacid | 400-76-0 | 2A-9068874 |
| (3-(trifluoromethyl)pyridin-2-yl)methanamine | 886371-24-0 | 2A-9068877 |
| (5-(trifluoromethyl)pyridin-3-yl)methanamine | 766513-53-5 | 2A-9068886 |
| (5-Methyl-3-trifluoromethyl-pyrazol-1-yl)-aceticacid | 345637-71-0 | 2A-9068889 |
| (E)-3-(dimethylamino)-2-phenylacrylaldehyde | 5131-89-2 | 2A-9068894 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA