
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 319457-34-6 |
| Catalog No. | 2A-9068794 |
| Chinese Name | 2-乙酰基-3,6-二氟苯甲酸 |
| Synonyms | 2-Acetyl-3,6-difluorobenzoic acid; MFCD00800682; PC3688; acetyldifluorobenzoic acid |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.216 |
| Density | 1.41g/cm3 |
| Boiling Point | 314.5ºC at 760mmHg |
| Melting Point | 83-88ºC |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2918300090 |
| MDL Number | MFCD00156995 |
| SMILES | CC(=O)c1c(F)ccc(F)c1C(=O)O |
| InChI Key | IHGWIRJWNPNDTJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| methyl2-amino-3-(4-chlorophenyl)propanoate | 23434-96-0 | 2A-9068786 |
| 2-(4-chloro-2-methoxyphenoxy)aceticacid | 56913-08-7 | 2A-9068787 |
| 2-bromo-1-(4-hydroxy-3-methoxyphenyl)ethanone | 69638-06-8 | 2A-9068790 |
| Ohchininacetate | 67023-81-8 | 2A-9068791 |
| Isocalamendiol | 25330-21-6 | 2A-9068793 |
| 2-bromo-4-methoxyaniline | 32338-02-6 | 2A-9068796 |
| Savinin | 493-95-8 | 2A-9068797 |
| 3-(dimethylamino)-4-methoxybenzoicacid | 197500-33-7 | 2A-9068798 |
| 6-O-Feruloylglucose | 137887-25-3 | 2A-9068800 |
| methyl3-(4-bromophenyl)acrylate | 3650-78-0 | 2A-9068803 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA