
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5027-76-9 |
| Catalog No. | 2A-9068756 |
| Chinese Name | Oleuropeic acid |
| Synonyms | (4S)-4-(2-Hydroxy-2-propanyl)-1-cyclohexene-1-carboxylic acid |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.232 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 319.6±25.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | 2-8℃, dry, sealed |
| HTC | 2918199090 |
| SMILES | CC(C)(O)C1CC=C(C(=O)O)CC1 |
| InChI | InChI=1S/C10H16O3/c1-10(2,13)8-5-3-7(4-6-8)9(11)12/h3,8,13H,4-6H2,1-2H3,(H,11,12)/t8-/m1/s1 |
| InChI Key | BFYWJELXORKNFO-MRVPVSSYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ErigesideC | 112667-09-1 | 2A-9068748 |
| 1,1,2,2-Tetramethylethyltrimethoxysilane | 142877-45-0 | 2A-9068749 |
| ArillatoseB | 137941-45-8 | 2A-9068753 |
| Methyl3-formyl-4-hydroxyphenylacetate | 61874-04-2 | 2A-9068754 |
| Decarine | 54354-62-0 | 2A-9068755 |
| CunilosideB | 1187303-40-7 | 2A-9068757 |
| 1-(3-Cyanopyridyl-2)-2-phenyl-4-methylpyperazine | 61337-88-0 | 2A-9068760 |
| 2,4,6-Trichlorobenzenesulfonylchloride | 51527-73-2 | 2A-9068761 |
| 3-Nitrophenylethylamine | 90271-37-7 | 2A-9068762 |
| 2-aminoethylbenzenesulfonate | 771582-62-8 | 2A-9068764 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA